![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | Genos (1992-02)(Pressimage)(fr)(Disk 2 of 2)[monochrome].zip | 2011-12-05 12:43 | 2.5K | |
![[ ]](/icons/compressed.gif) | Morecopy (19xx)(End Software).zip | 2011-12-05 12:43 | 6.7K | |
![[ ]](/icons/compressed.gif) | Aladin Disk (19xx)(-)[a3].zip | 2011-12-05 12:42 | 8.7K | |
![[ ]](/icons/compressed.gif) | Ansi ST v0.40 (1994-05-07)(Uncensored Software).zip | 2011-12-05 12:42 | 11K | |
![[ ]](/icons/compressed.gif) | Biorythmes (1985-09-14)(Cobra Soft)(fr).zip | 2011-12-05 12:42 | 16K | |
![[ ]](/icons/compressed.gif) | Harddiskdriver v5.5.0 (1991)(ICD)(de)[a].zip | 2011-12-05 12:43 | 16K | |
![[ ]](/icons/compressed.gif) | Powersaver 1.50 (19xx)(Andersen, Tommy)(PD).zip | 2011-12-05 12:43 | 17K | |
![[ ]](/icons/compressed.gif) | Dungeon Master Editor, The v2.20 (1988)(Softex).zip | 2011-12-05 12:42 | 17K | |
![[ ]](/icons/compressed.gif) | Font Selector (19xx)(Budgie UK)(LW).zip | 2011-12-05 12:43 | 17K | |
![[ ]](/icons/compressed.gif) | Hodgepodge (19xx)(Pesch, Heinrich)(de)(PD).zip | 2011-12-05 12:43 | 18K | |
![[ ]](/icons/compressed.gif) | Bubble Bobble Construction Kit (19xx)(-).zip | 2011-12-05 12:42 | 20K | |
![[ ]](/icons/compressed.gif) | Makeicon (1987)(Pressimage)(fr)(PD).zip | 2011-12-05 12:43 | 21K | |
![[ ]](/icons/compressed.gif) | Desktop (19xx)(Clasen, Peter)(de).zip | 2011-12-05 12:42 | 23K | |
![[ ]](/icons/compressed.gif) | Kurztext (1989-11)(Pesch, (Heinrich)(de)(PD).zip | 2011-12-05 12:43 | 24K | |
![[ ]](/icons/compressed.gif) | MagiC Hack v3.0 (1995-06-22)(Binder, Thomas)[Falcon only].zip | 2011-12-05 12:43 | 24K | |
![[ ]](/icons/compressed.gif) | Keytext (1989-11)(Pesch, (Heinrich)(PD)[german readme].zip | 2011-12-05 12:43 | 24K | |
![[ ]](/icons/compressed.gif) | MagiC Hack v3.0 (1995-06-22)(Binder, Thomas)[a][Falcon only].zip | 2011-12-05 12:43 | 24K | |
![[ ]](/icons/compressed.gif) | MagiC Hack v2.0 (1995-06-22)(Binder, Thomas)[Falcon only].zip | 2011-12-05 12:43 | 24K | |
![[ ]](/icons/compressed.gif) | Midi Maze Editor & Maze Convertor v1.2 (2000-04-13)(Spruck, Bjoern)(PD).zip | 2011-12-05 12:43 | 25K | |
![[ ]](/icons/compressed.gif) | Autohack v4.13 (19xx)(Amazing Un-Nameables).zip | 2011-12-05 12:42 | 25K | |
![[ ]](/icons/compressed.gif) | AS Sound Sampler (19xx)(Application Service Software)[cr Lockman III].zip | 2011-12-05 12:42 | 25K | |
![[ ]](/icons/compressed.gif) | MSA II v2.3 (19xx)(WAZ)(PD).zip | 2011-12-05 12:43 | 28K | |
![[ ]](/icons/compressed.gif) | Circinus v1.1D (1991-09-08)(Rabich, Dietmar)(de)(PD)[a].zip | 2011-12-05 12:42 | 29K | |
![[ ]](/icons/compressed.gif) | Evolution (19xx)(Data Becker)(de)(PD).zip | 2011-12-05 12:42 | 29K | |
![[ ]](/icons/compressed.gif) | Circinus v1.1D (1991-09-08)(Rabich, Dietmar)(de)(PD).zip | 2011-12-05 12:42 | 30K | |
![[ ]](/icons/compressed.gif) | Ascgif v1.6 (19xx)(Klink, Oliver).zip | 2011-12-05 12:42 | 31K | |
![[ ]](/icons/compressed.gif) | Paset Address v1.1 (19xx)(Rauch, Alexander)(fr)(SW).zip | 2011-12-05 12:43 | 32K | |
![[ ]](/icons/compressed.gif) | Andyload (19xx)(Andy the Arfling).zip | 2011-12-05 12:42 | 33K | |
![[ ]](/icons/compressed.gif) | BlowUP 30 (19xx)(Acher, Georg - Eberl, Michael)[cr Trash][Falcon only].zip | 2011-12-05 12:42 | 35K | |
![[ ]](/icons/compressed.gif) | Critical Path v1.10 (demo) (1990)(Schwane Software).zip | 2011-12-05 12:42 | 37K | |
![[ ]](/icons/compressed.gif) | Cocktails (1987)(Bernard, Michel)(fr).zip | 2011-12-05 12:42 | 38K | |
![[ ]](/icons/compressed.gif) | Minstrel v1.01 (1986)(Laidler, Paul)[m Atariforce].zip | 2011-12-05 12:43 | 38K | |
![[ ]](/icons/compressed.gif) | Megakey (19xx)(Bouchaud, Frank)(fr)(PD).zip | 2011-12-05 12:43 | 38K | |
![[ ]](/icons/compressed.gif) | Harddisk Treiber v4.13 (1991)(Digital Data Deicke)(de).zip | 2011-12-05 12:43 | 40K | |
![[ ]](/icons/compressed.gif) | Agi Piano v1.0 (1998)(Temple, Rainer de)[cr Starman].zip | 2011-12-05 12:42 | 41K | |
![[ ]](/icons/compressed.gif) | QLS-Verwaltung (19xx)(-)(de)[b].zip | 2011-12-05 12:43 | 41K | |
![[ ]](/icons/compressed.gif) | Arc Shell (1991)(Johnson, Charles F.).zip | 2011-12-05 12:42 | 43K | |
![[ ]](/icons/compressed.gif) | Genos (1992-02)(Pressimage)(fr)(Disk 1 of 2)[monochrome].zip | 2011-12-05 12:43 | 43K | |
![[ ]](/icons/compressed.gif) | ProbeST v2.00 (1992)(Breakpoint)(SW).zip | 2011-12-05 12:43 | 43K | |
![[ ]](/icons/compressed.gif) | ProbeST v1.01 (1992-03-15)(Breakpoint)(SW).zip | 2011-12-05 12:43 | 43K | |
![[ ]](/icons/compressed.gif) | ProbeST v1.01 (1992-03-15)(Breakpoint)(SW)[a].zip | 2011-12-05 12:43 | 43K | |
![[ ]](/icons/compressed.gif) | Fastcopy III (1990-01-13)(Backschat, Martin)(FW)[m AtariCD].zip | 2011-12-05 12:43 | 44K | |
![[ ]](/icons/compressed.gif) | Deskpic v1.05 (199x)(Marschalleck, Norbert)(de)(FW).zip | 2011-12-05 12:42 | 45K | |
![[ ]](/icons/compressed.gif) | Boozgem 2.1.3 BETA (19xx)(Dorman, Michael Alan).zip | 2011-12-05 12:42 | 45K | |
![[ ]](/icons/compressed.gif) | Graphico v2.0 (1990-10)(Kopp, Gabriel)[monochrome].zip | 2011-12-05 12:43 | 45K | |
![[ ]](/icons/compressed.gif) | Pasmanag v1.03 (1989-07-18)(Hain, Rainer)(de)(PD).zip | 2011-12-05 12:43 | 47K | |
![[ ]](/icons/compressed.gif) | Liberty v1.31 (1998-09-20)(Krueger, Christian)(de)(FW)[u].zip | 2011-12-05 12:43 | 48K | |
![[ ]](/icons/compressed.gif) | Atabank (19xx)(Pressimage)(fr)(SW)[monochrome].zip | 2011-12-05 12:42 | 48K | |
![[ ]](/icons/compressed.gif) | Creation Musical v1.2 (19xx)(-).zip | 2011-12-05 12:42 | 49K | |
![[ ]](/icons/compressed.gif) | Gogo ST v5.0 (1992)(Cawthon, Mark)(SW).zip | 2011-12-05 12:43 | 49K | |
![[ ]](/icons/compressed.gif) | Atari Logo (1985)(Atari Corp.)(fr).zip | 2011-12-05 12:42 | 49K | |
![[ ]](/icons/compressed.gif) | Q.I. sexuel (1986)(Sosoye the Venger)(fr).zip | 2011-12-05 12:43 | 50K | |
![[ ]](/icons/compressed.gif) | Gravex Boot v2.0 (1991)(DNT Crew - Pips).zip | 2011-12-05 12:43 | 51K | |
![[ ]](/icons/compressed.gif) | Pro Sample Editor v3.04 (1988-11-24)(JCD Midi Softs).zip | 2011-12-05 12:43 | 51K | |
![[ ]](/icons/compressed.gif) | Luescher Color Test (19xx)(Denison, Alan).zip | 2011-12-05 12:43 | 52K | |
![[ ]](/icons/compressed.gif) | ASCII View v3.75 (19xx)(Seberg, David M.).zip | 2011-12-05 12:42 | 53K | |
![[ ]](/icons/compressed.gif) | Midimix Configurateur (1988)(JCDMS)(fr)[a].zip | 2011-12-05 12:43 | 55K | |
![[ ]](/icons/compressed.gif) | Playmeup v1.05g (1997)(Faika, Richard Gordon)(de)(FW).zip | 2011-12-05 12:43 | 56K | |
![[ ]](/icons/compressed.gif) | Professional Mega Ripper (19xx)(Positivity)[a2].zip | 2011-12-05 12:43 | 57K | |
![[ ]](/icons/compressed.gif) | AHDI v4.02 (1990-12-06)(Atari Corp.)[a].zip | 2011-12-05 12:42 | 57K | |
![[ ]](/icons/compressed.gif) | GenPatch ST MIDI Librarian (1986)(Hybrid Arts).zip | 2011-12-05 12:43 | 57K | |
![[ ]](/icons/compressed.gif) | AHDI v4.02 (1990-12-06)(Atari Corp.).zip | 2011-12-05 12:42 | 57K | |
![[ ]](/icons/compressed.gif) | 3D Molecule Modeler v2.1 (1987)(Erpeh)(PD).zip | 2011-12-05 12:42 | 57K | |
![[ ]](/icons/compressed.gif) | Arc Shell v1.3 (19xx)(-).zip | 2011-12-05 12:42 | 58K | |
![[ ]](/icons/compressed.gif) | BetaDos v3.12 (2003-03-08)(Andersson, Ronald).zip | 2011-12-05 12:42 | 59K | |
![[ ]](/icons/compressed.gif) | GenPatch ST MIDI Librarian (1986)(Hybrid Arts)[a].zip | 2011-12-05 12:43 | 59K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.07 (19xx)(GFA Systemtechnik)(fr).zip | 2011-12-05 12:43 | 59K | |
![[ ]](/icons/compressed.gif) | FlexiDisc v1.2 (1988-07-07)(Application Systems Paris)(fr).zip | 2011-12-05 12:43 | 60K | |
![[ ]](/icons/compressed.gif) | Pro Sprite Designer (19xx)(Triangle Publishing)[b].zip | 2011-12-05 12:43 | 60K | |
![[ ]](/icons/compressed.gif) | Mbuse-Ka-Mania II (1994)(LGF).zip | 2011-12-05 12:43 | 60K | |
![[ ]](/icons/compressed.gif) | MIDIman v1.4 & Trackman Demostration v2.2 (1990)(Hollis Research)(Disk 2 of 2).zip | 2011-12-05 12:43 | 63K | |
![[ ]](/icons/compressed.gif) | ConXBOOT v1.01 (2000-11-27)(Stehlik, Petr)(FW).zip | 2011-12-05 12:42 | 63K | |
![[ ]](/icons/compressed.gif) | DFBoot 2 v2.20 (1999-08)(Floch, Denis)(fr).zip | 2011-12-05 12:42 | 64K | |
![[ ]](/icons/compressed.gif) | Minstrel v2.02 (1988)(Laidler, Paul).zip | 2011-12-05 12:43 | 64K | |
![[ ]](/icons/compressed.gif) | Midijazz v1.0 (1989)(Midigam)(fr).zip | 2011-12-05 12:43 | 64K | |
![[ ]](/icons/compressed.gif) | Logitheque Master v 3.0 (19xx)(Laury, Philippe)(fr)[m Atariforce].zip | 2011-12-05 12:43 | 65K | |
![[ ]](/icons/compressed.gif) | CZ-Rider Editor-Librarian v3.00 (1990)(Caged Artist).zip | 2011-12-05 12:42 | 65K | |
![[ ]](/icons/compressed.gif) | Plus Paint ST v1.02 (19xx)(Micro-Application).zip | 2011-12-05 12:43 | 66K | |
![[ ]](/icons/compressed.gif) | ProbeST v2.00 (1992)(Breakpoint)(SW)[a].zip | 2011-12-05 12:43 | 68K | |
![[ ]](/icons/compressed.gif) | AHDI v6.06 (1993-06-02)(Atari Corp.).zip | 2011-12-05 12:42 | 68K | |
![[ ]](/icons/compressed.gif) | Klomanager Source Code (19xx)(-).zip | 2011-12-05 12:43 | 69K | |
![[ ]](/icons/compressed.gif) | Freedom v1.00 (1995-01-06)(Krueger, Christian - Kolja Koischwitz)(de).zip | 2011-12-05 12:43 | 70K | |
![[ ]](/icons/compressed.gif) | Atari Language Disk 1040ST (1986)(Atari Corp.).zip | 2011-12-05 12:42 | 71K | |
![[ ]](/icons/compressed.gif) | Atari Language Disk Mega ST (19xx)(Atari Corp.).zip | 2011-12-05 12:42 | 71K | |
![[ ]](/icons/compressed.gif) | Degas Elite v1.0 (1986)(Batteries Included)[a].zip | 2011-12-05 12:42 | 71K | |
![[ ]](/icons/compressed.gif) | Arkanoid Editor (1987-05-31)(Dutch Muggers Association)[a].zip | 2011-12-05 12:42 | 71K | |
![[ ]](/icons/compressed.gif) | Music Tutor, The v2.0 (1992)(Symphonic Software).zip | 2011-12-05 12:43 | 72K | |
![[ ]](/icons/compressed.gif) | Music Tutor, The v2.0 (1992)(Symphonic Software)[a].zip | 2011-12-05 12:43 | 72K | |
![[ ]](/icons/compressed.gif) | Atari Language Disk STE (19xx)(Atari Corp.).zip | 2011-12-05 12:42 | 72K | |
![[ ]](/icons/compressed.gif) | Arkanoid Editor (1987-05-31)(Dutch Muggers Association).zip | 2011-12-05 12:42 | 72K | |
![[ ]](/icons/compressed.gif) | AHDI v2.0 (1988)(Atari Corp.).zip | 2011-12-05 12:42 | 72K | |
![[ ]](/icons/compressed.gif) | Music Studio Disk 1 (19xx)(Dilithium).zip | 2011-12-05 12:43 | 73K | |
![[ ]](/icons/compressed.gif) | ASCII to ASCII v 2.0 (2000)(Landemarre, Olivier)(fr).zip | 2011-12-05 12:42 | 73K | |
![[ ]](/icons/compressed.gif) | Numeyoga v1.1 (1993-08-28)(Pochat, Wilfried)(FW).zip | 2011-12-05 12:43 | 74K | |
![[ ]](/icons/compressed.gif) | KnifeST v1.10 (1991-05-07)(HiSoft).zip | 2011-12-05 12:43 | 74K | |
![[ ]](/icons/compressed.gif) | Clocky v2.37 (19xx)(Stehlik, Petr).zip | 2011-12-05 12:42 | 75K | |
![[ ]](/icons/compressed.gif) | Bootsector Construction Set v 1.64 (1994)(Roche, X.).zip | 2011-12-05 12:42 | 75K | |
![[ ]](/icons/compressed.gif) | Jade (1988)(MBC)(fr).zip | 2011-12-05 12:43 | 76K | |
![[ ]](/icons/compressed.gif) | Astrolab - Astronomie de Position (1988)(Gueguen, Yves Louis)(fr).zip | 2011-12-05 12:42 | 77K | |
![[ ]](/icons/compressed.gif) | Jade (1988)(MBC)(fr)[cr MCS].zip | 2011-12-05 12:43 | 77K | |
![[ ]](/icons/compressed.gif) | Handy-Reader v3.01 (1989-03-04)(Cameron)(M3).zip | 2011-12-05 12:43 | 77K | |
![[ ]](/icons/compressed.gif) | PC-Ditto vx.xx (19xx)(Avant-Garde Systems)[b].zip | 2011-12-05 12:43 | 77K | |
![[ ]](/icons/compressed.gif) | Midimix Configurateur (1988)(JCDMS)(fr)[a2].zip | 2011-12-05 12:43 | 78K | |
![[ ]](/icons/compressed.gif) | Flexidumb color v3.03 (1990)(Zitasoft)(Disk 1 of 2).zip | 2011-12-05 12:43 | 79K | |
![[ ]](/icons/compressed.gif) | CZ Andruid Source (19xx)(Abyss).zip | 2011-12-05 12:42 | 79K | |
![[ ]](/icons/compressed.gif) | Audio Sculpture (1990)(Synchron Assembly)[Evaluation Version].zip | 2011-12-05 12:42 | 79K | |
![[ ]](/icons/compressed.gif) | Love Pack (19xx)(Bigupitti, Yokihiru)(PD)[XXX].zip | 2011-12-05 12:43 | 80K | |
![[ ]](/icons/compressed.gif) | GFA Tutorial (1988-07-15)(Hayslett, Tom).zip | 2011-12-05 12:43 | 81K | |
![[ ]](/icons/compressed.gif) | Chartpak ST (1987)(Wainwright, R.C.).zip | 2011-12-05 12:42 | 82K | |
![[ ]](/icons/compressed.gif) | Loto Plus v1.01 (19xx)(Goguillon, Louis - MC3).zip | 2011-12-05 12:43 | 82K | |
![[ ]](/icons/compressed.gif) | Flash v1.12 (1986)(Antic)[a].zip | 2011-12-05 12:43 | 82K | |
![[ ]](/icons/compressed.gif) | KAOSDesk v2.01 (1989)(Kromke, Andreas)(de).zip | 2011-12-05 12:43 | 84K | |
![[ ]](/icons/compressed.gif) | Diskstar (19xx)(Maxon)(de).zip | 2011-12-05 12:42 | 85K | |
![[ ]](/icons/compressed.gif) | 1st Mail v2.18 (1987)(GST)(fr).zip | 2011-12-05 12:42 | 85K | |
![[ ]](/icons/compressed.gif) | Electronicien, L' v1.1 (1989)(Miotti, Luc)(fr).zip | 2011-12-05 12:42 | 86K | |
![[ ]](/icons/compressed.gif) | Procopy v1.50 (1987)(Proco Products).zip | 2011-12-05 12:43 | 86K | |
![[ ]](/icons/compressed.gif) | Profiler fuer Pascal Quellcode (1989)(MKB)(de).zip | 2011-12-05 12:43 | 86K | |
![[ ]](/icons/compressed.gif) | Desassembleur 68000 v1.0 (1986-10)(Loriciels)(fr).zip | 2011-12-05 12:42 | 86K | |
![[ ]](/icons/compressed.gif) | Discovery Cartridge Tools (1988)(Happy Computer)[a4].zip | 2011-12-05 12:42 | 86K | |
![[ ]](/icons/compressed.gif) | Midigrid Professional (19xx)(University of York)[cr Elite].zip | 2011-12-05 12:43 | 87K | |
![[ ]](/icons/compressed.gif) | Astronomie v1.1 (1990)(Maurelle, Vincent)(fr).zip | 2011-12-05 12:42 | 87K | |
![[ ]](/icons/compressed.gif) | Laborant ST Plus v1 (1988)(Schulz, Jens)(de)(PD).zip | 2011-12-05 12:43 | 87K | |
![[ ]](/icons/compressed.gif) | Audio Sculpture (1990)(Synchron Assembly)[cr Replicants].zip | 2011-12-05 12:42 | 88K | |
![[ ]](/icons/compressed.gif) | Pic Switch v0.7 (1987)(Brochu, John)(SW).zip | 2011-12-05 12:43 | 89K | |
![[ ]](/icons/compressed.gif) | Deluxe Piano (1986-03-21)(Intersect)(PD).zip | 2011-12-05 12:42 | 90K | |
![[ ]](/icons/compressed.gif) | Music Studio '88, The (1988)(Activision).zip | 2011-12-05 12:43 | 90K | |
![[ ]](/icons/compressed.gif) | Digital v2.0 (1988)(Heim-Verlag Darmstadt-Eberstadt)(de)[monochrome].zip | 2011-12-05 12:42 | 90K | |
![[ ]](/icons/compressed.gif) | Platon v2.1 (1991-02-19)(VHF)(de)(Disk 3 of 3)[cr].zip | 2011-12-05 12:43 | 91K | |
![[ ]](/icons/compressed.gif) | Adressbuchle v2.0 (1988)(Joker Soft)(de).zip | 2011-12-05 12:42 | 91K | |
![[ ]](/icons/compressed.gif) | PC-Ditto v3.64 (1988)(Avant-Garde Systems)[a].zip | 2011-12-05 12:43 | 92K | |
![[ ]](/icons/compressed.gif) | D50 Editor (19xx)(-)[b].zip | 2011-12-05 12:42 | 92K | |
![[ ]](/icons/compressed.gif) | Jam v1.0 (1990)(Michel, J.)(fr).zip | 2011-12-05 12:43 | 92K | |
![[ ]](/icons/compressed.gif) | Discovery Cartridge Tools (1988)(Happy Computer)[a5].zip | 2011-12-05 12:42 | 92K | |
![[ ]](/icons/compressed.gif) | Deskpic v1.00 (1992)(Marschalleck, Norbert)(de)(FW).zip | 2011-12-05 12:42 | 92K | |
![[ ]](/icons/compressed.gif) | Jazz Guitarist v1.0 (1993)(PG Music)(Disk 3 of 3).zip | 2011-12-05 12:43 | 93K | |
![[ ]](/icons/compressed.gif) | Music Studio Disk 1 (19xx)(Dilithium)[a].zip | 2011-12-05 12:43 | 93K | |
![[ ]](/icons/compressed.gif) | Midimix Configurateur (1988)(JCDMS)(fr).zip | 2011-12-05 12:43 | 93K | |
![[ ]](/icons/compressed.gif) | Music Studio, The (1986)(Activision)[a].zip | 2011-12-05 12:43 | 93K | |
![[ ]](/icons/compressed.gif) | Artkraft v1.3 (1987)(Rees, Christian)(de).zip | 2011-12-05 12:42 | 94K | |
![[ ]](/icons/compressed.gif) | Backward III v1.00 (1995-09-06)(C. Dupuydauby)[Falcon only].zip | 2011-12-05 12:42 | 94K | |
![[ ]](/icons/compressed.gif) | Cyber Sculpt 3D Modeling Package v1.0 (1988)(Antic).zip | 2011-12-05 12:42 | 95K | |
![[ ]](/icons/compressed.gif) | Picdesk v2.00a (1997-03-31)(Mequignon, Didier)(fr).zip | 2011-12-05 12:43 | 95K | |
![[ ]](/icons/compressed.gif) | Faaast Print for Signum Files (19xx)(Ingo Sprick)(de).zip | 2011-12-05 12:42 | 96K | |
![[ ]](/icons/compressed.gif) | Faaast Print for Signum Files (19xx)(Ingo Sprick)(de)[a].zip | 2011-12-05 12:42 | 96K | |
![[ ]](/icons/compressed.gif) | Backward III v1.00 (1995-09-06)(C. Dupuydauby)[a][Falcon only].zip | 2011-12-05 12:42 | 96K | |
![[ ]](/icons/compressed.gif) | Arbre Genealogique (1992-12)(Pressimage).zip | 2011-12-05 12:42 | 96K | |
![[ ]](/icons/compressed.gif) | Lasergraph Pro v2.50 (1991)(Bonnifet, S. - Guimberteau, P.)(Disk 4 of 6)(Disk Imagraph 2)[cr ICS].zip | 2011-12-05 12:43 | 97K | |
![[ ]](/icons/compressed.gif) | Kuma Spreadsheet v2.19 (1986)(Kuma Computers Limited).zip | 2011-12-05 12:43 | 97K | |
![[ ]](/icons/compressed.gif) | Atabase (19xx))(Lambin, Andre)(M4)[monochrome].zip | 2011-12-05 12:42 | 97K | |
![[ ]](/icons/compressed.gif) | Formula v2.0 (19xx)(Maxon)(fr)[cr Bad Boys - Replicants].zip | 2011-12-05 12:43 | 98K | |
![[ ]](/icons/compressed.gif) | CAD-3D v2.02 (1987)(Exclusive Distribution)[b].zip | 2011-12-05 12:42 | 98K | |
![[ ]](/icons/compressed.gif) | DAATAscan Professional v2.40 (1991)(PML).zip | 2011-12-05 12:42 | 98K | |
![[ ]](/icons/compressed.gif) | Metamcomco Screen Editor v1.6 (1985)(Tenchstar).zip | 2011-12-05 12:43 | 99K | |
![[ ]](/icons/compressed.gif) | EZ-Track ST (demo-playable) (1986-07-17)(Hybrid Arts).zip | 2011-12-05 12:42 | 99K | |
![[ ]](/icons/compressed.gif) | DigiTape v1.04 (demo-playable) (1993)(TradeIt)[Falcon only].zip | 2011-12-05 12:42 | 99K | |
![[ ]](/icons/compressed.gif) | AHDI v6.061 (1993-07-17)(Atari Corp.).zip | 2011-12-05 12:42 | 99K | |
![[ ]](/icons/compressed.gif) | POV Include (19xx)(-).zip | 2011-12-05 12:43 | 99K | |
![[ ]](/icons/compressed.gif) | Atari ST Language Disk (1985)(Atari Corp.).zip | 2011-12-05 12:42 | 99K | |
![[ ]](/icons/compressed.gif) | Atari TT Desktop for ST (19xx)(-)[German Readme].zip | 2011-12-05 12:42 | 99K | |
![[ ]](/icons/compressed.gif) | Interdigit v1.4 (1988-08-18)(Talmy, Emmanuel)(fr).zip | 2011-12-05 12:43 | 101K | |
![[ ]](/icons/compressed.gif) | Arranger ST v2.0 (1990)(Zadok Products)(Disk 2 of 2)[cr Elite].zip | 2011-12-05 12:42 | 102K | |
![[ ]](/icons/compressed.gif) | Calcomat 2 v6.14 (1988-02-22)(Micro-Application)(fr).zip | 2011-12-05 12:42 | 102K | |
![[ ]](/icons/compressed.gif) | Music Studio, The (1986)(Activision).zip | 2011-12-05 12:43 | 103K | |
![[ ]](/icons/compressed.gif) | Calcomat 2 v6.20 (1988-03-31)(Micro-Application)(fr).zip | 2011-12-05 12:42 | 103K | |
![[ ]](/icons/compressed.gif) | Daily Mail v1.21 (1989)(Applications Systems)(fr)[monochrome].zip | 2011-12-05 12:42 | 105K | |
![[ ]](/icons/compressed.gif) | Picture Desk v2.04b (2004-05)(Mequignon, Didier)(en-fr).zip | 2011-12-05 12:43 | 105K | |
![[ ]](/icons/compressed.gif) | Midnight v1.0 (1990-12)(Rythm'n Soft)(fr).zip | 2011-12-05 12:43 | 105K | |
![[ ]](/icons/compressed.gif) | Chameleon Universal Patch Librarian v1.1 (1989)(Keynote Music Software)[cr MCA].zip | 2011-12-05 12:42 | 106K | |
![[ ]](/icons/compressed.gif) | Astronomy Lab ST, The v1.05 (1989-09-04)(Simple Logic).zip | 2011-12-05 12:42 | 106K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v3.01 (19xx)(Steinberg)(Disk 3 of 3).zip | 2011-12-05 12:42 | 106K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v3.01 (1992)(Steinberg)(Disk 3 of 3)[a].zip | 2011-12-05 12:42 | 107K | |
![[ ]](/icons/compressed.gif) | Ludwig v1.0 (1988-09-20)(Bajoras, Tom)(FW).zip | 2011-12-05 12:43 | 107K | |
![[ ]](/icons/compressed.gif) | No Limit's 2001 (1991)(Print-Technik).zip | 2011-12-05 12:43 | 107K | |
![[ ]](/icons/compressed.gif) | Liberty v1.31 (1998-09-20)(Krueger, Christian)(de)(FW)[a].zip | 2011-12-05 12:43 | 107K | |
![[ ]](/icons/compressed.gif) | Lizard v1.0 (1991)(Digisoft Music)[cr Elite].zip | 2011-12-05 12:43 | 108K | |
![[ ]](/icons/compressed.gif) | FM Melody Maker (1989-10-01)(Richard Watts Associates - Upgrade Editions)(fr).zip | 2011-12-05 12:42 | 109K | |
![[ ]](/icons/compressed.gif) | Degas Elite v1.1 (1986)(Batteries Included)[a].zip | 2011-12-05 12:42 | 109K | |
![[ ]](/icons/compressed.gif) | Discovery Cartridge Tools (1988)(Happy Computer)[a2].zip | 2011-12-05 12:42 | 109K | |
![[ ]](/icons/compressed.gif) | Discovery Cartridge Tools (1988)(Happy Computer)[a3].zip | 2011-12-05 12:42 | 109K | |
![[ ]](/icons/compressed.gif) | Easyshell v2.00 (19xx)(Braunstein, Armin)(de)[password on disk].zip | 2011-12-05 12:42 | 110K | |
![[ ]](/icons/compressed.gif) | Freestyle Pro (1992-01-09)(Sound Pool)(Disk 1 of 2)[cr Elite].zip | 2011-12-05 12:43 | 110K | |
![[ ]](/icons/compressed.gif) | Liberty v1.31 (1998-09-20)(Krueger, Christian)(de)(FW).zip | 2011-12-05 12:43 | 110K | |
![[ ]](/icons/compressed.gif) | Geometrie v1.1 (1987)(Hirtzler, Michel)(fr).zip | 2011-12-05 12:43 | 111K | |
![[ ]](/icons/compressed.gif) | NEOchrome Master v2.28 (1992-03-24)(Chaos Inc.)[cr Delte Force].zip | 2011-12-05 12:43 | 111K | |
![[ ]](/icons/compressed.gif) | CLA Logic v1.0 (1992-06-01)(Data Uncertain Software)(SW)[monochrome].zip | 2011-12-05 12:42 | 111K | |
![[ ]](/icons/compressed.gif) | DA's Vektor v1.2 (1993-01-24)(Digital Arts)(de)(Disk 7 of 7).zip | 2011-12-05 12:42 | 111K | |
![[ ]](/icons/compressed.gif) | Librairies Dynamiques GEM v2.30 (2002-05)(Landemarre, Olivier)(en-fr)(FW)[u].zip | 2011-12-05 12:43 | 111K | |
![[ ]](/icons/compressed.gif) | Miroir Astral (1991)(Uranie Software)(fr).zip | 2011-12-05 12:43 | 111K | |
![[ ]](/icons/compressed.gif) | Overlay v0.10.3 (demo-playable) (1993)(OverScan)(Disk 1 of 3).zip | 2011-12-05 12:43 | 112K | |
![[ ]](/icons/compressed.gif) | Atari Language Disk STE (19xx)(Atari Corp.)(fr).zip | 2011-12-05 12:42 | 112K | |
![[ ]](/icons/compressed.gif) | Doctor Drum (1991-08)(Heavenly Music)(Disk 2 of 2).zip | 2011-12-05 12:42 | 112K | |
![[ ]](/icons/compressed.gif) | Degas Elite v1.1 (1986)(Batteries Included).zip | 2011-12-05 12:42 | 112K | |
![[ ]](/icons/compressed.gif) | Architecte, L' (19xx)(-)(fr)[b].zip | 2011-12-05 12:42 | 112K | |
![[ ]](/icons/compressed.gif) | Family Tree Data (19xx)(-).zip | 2011-12-05 12:42 | 113K | |
![[ ]](/icons/compressed.gif) | EZ-Score Plus v1.0 (1987)(Hybrid Arts)[b].zip | 2011-12-05 12:42 | 113K | |
![[ ]](/icons/compressed.gif) | Personal Pascal v1.00 (1986)(CCD - OSS).zip | 2011-12-05 12:43 | 113K | |
![[ ]](/icons/compressed.gif) | Atari Language Disk STE (19xx)(Atari Corp.)(fr)[a].zip | 2011-12-05 12:42 | 113K | |
![[ ]](/icons/compressed.gif) | Omikron Basic v3.01 (1988)(Omikron).zip | 2011-12-05 12:43 | 113K | |
![[ ]](/icons/compressed.gif) | Noise Tracker v1.5 (19xx)(Empire)[a2].zip | 2011-12-05 12:43 | 113K | |
![[ ]](/icons/compressed.gif) | Liberty v1.31 (1998-09-20)(Krueger, Christian)(de)(FW)[a2].zip | 2011-12-05 12:43 | 113K | |
![[ ]](/icons/compressed.gif) | Lattice C (19xx)(Hisoft)[a].zip | 2011-12-05 12:43 | 114K | |
![[ ]](/icons/compressed.gif) | Flash v1.12 (1986)(Antic).zip | 2011-12-05 12:42 | 114K | |
![[ ]](/icons/compressed.gif) | Brainbox (1988)(CRL Group)(Disk 2 of 2)[cr Powers That Be].zip | 2011-12-05 12:42 | 114K | |
![[ ]](/icons/compressed.gif) | Handy-Painter v2.0 (1989-03-08)(Cameron)(fr).zip | 2011-12-05 12:43 | 115K | |
![[ ]](/icons/compressed.gif) | MiNT v0.95 (1992-05-08)(Atari Corp.)(Disk 2 of 2).zip | 2011-12-05 12:43 | 115K | |
![[ ]](/icons/compressed.gif) | Doctor Drum (1991-08)(Heavenly Music)(Disk 1 of 2).zip | 2011-12-05 12:42 | 115K | |
![[ ]](/icons/compressed.gif) | Clocky v3.00 (19xx)(Stehlik, Petr).zip | 2011-12-05 12:42 | 115K | |
![[ ]](/icons/compressed.gif) | EOS v1.42 (1992)(System Solutions).zip | 2011-12-05 12:42 | 115K | |
![[ ]](/icons/compressed.gif) | Lasergraph Pro v2.50 (1991)(Bonnifet, S. - Guimberteau, P.)(Disk 5 of 6)(Disk Imagraph 3)[cr ICS].zip | 2011-12-05 12:43 | 116K | |
![[ ]](/icons/compressed.gif) | Professional Mega Ripper (19xx)(Positivity)[a].zip | 2011-12-05 12:43 | 116K | |
![[ ]](/icons/compressed.gif) | Flexidumb color v3.03 (1990)(Zitasoft)(Disk 2 of 2).zip | 2011-12-05 12:43 | 116K | |
![[ ]](/icons/compressed.gif) | EZ-Track Plus ST (1988-04-22)(Hybrid Arts).zip | 2011-12-05 12:42 | 116K | |
![[ ]](/icons/compressed.gif) | Degas Elite v1.0 (1986)(Batteries Included)[a3].zip | 2011-12-05 12:42 | 117K | |
![[ ]](/icons/compressed.gif) | Assempro (1986)(Abacus).zip | 2011-12-05 12:42 | 117K | |
![[ ]](/icons/compressed.gif) | Printing Press, The v3.03 (1990-01-28)(Artz, Bernhard)[b].zip | 2011-12-05 12:43 | 118K | |
![[ ]](/icons/compressed.gif) | Paintworks (1986)(Audio Light)[b].zip | 2011-12-05 12:43 | 118K | |
![[ ]](/icons/compressed.gif) | Cubase Tutorial Disk (1989)(Steinberg).zip | 2011-12-05 12:42 | 118K | |
![[ ]](/icons/compressed.gif) | Mono Emulator, The (1987)(West, Mick)(SW).zip | 2011-12-05 12:43 | 118K | |
![[ ]](/icons/compressed.gif) | Miroir Astral (1991)(Uranie Software)(fr)[a].zip | 2011-12-05 12:43 | 118K | |
![[ ]](/icons/compressed.gif) | Maps and Legends - The Cartographer v3.05 (1987)(Antic).zip | 2011-12-05 12:43 | 119K | |
![[ ]](/icons/compressed.gif) | Muzaxx Rippozor v1.00 (1991)(Artis Magia)(fr)[a].zip | 2011-12-05 12:43 | 119K | |
![[ ]](/icons/compressed.gif) | Hdp Stack v1.02 (demo-playable) (1995-03-27)(Heyer - Neumann)(de).zip | 2011-12-05 12:43 | 119K | |
![[ ]](/icons/compressed.gif) | MIDIman v1.4 & Trackman Demostration v2.2 (1990)(Hollis Research)(Disk 1 of 2).zip | 2011-12-05 12:43 | 119K | |
![[ ]](/icons/compressed.gif) | Calendar - Appointment Book - Phone Book v1.22 (1992)(Atari Corp.).zip | 2011-12-05 12:42 | 119K | |
![[ ]](/icons/compressed.gif) | Chameleon Universal Patch Librarian v1.1 (1989)(Keynote Music Software).zip | 2011-12-05 12:42 | 120K | |
![[ ]](/icons/compressed.gif) | IC Draw v1.42 (1994-05-18)(Dr. Bob)(SW)[Falcon only].zip | 2011-12-05 12:43 | 120K | |
![[ ]](/icons/compressed.gif) | Printmaster (19xx)(-).zip | 2011-12-05 12:43 | 120K | |
![[ ]](/icons/compressed.gif) | Diskzine Construction Kit (1995)(Stosser).zip | 2011-12-05 12:42 | 120K | |
![[ ]](/icons/compressed.gif) | Midnight (demo) (1993-12)(Trifolium)(de).zip | 2011-12-05 12:43 | 121K | |
![[ ]](/icons/compressed.gif) | IC Draw v1.41 (1994-05-15)(Dr. Bob)(SW)[Falcon only].zip | 2011-12-05 12:43 | 121K | |
![[ ]](/icons/compressed.gif) | Atari Desktop for ST-TT Computer (1990-06-19)(Atari Corp.)(fr).zip | 2011-12-05 12:42 | 121K | |
![[ ]](/icons/compressed.gif) | Atari Mega STE Language Disk (1990)(Atari Corp.)[a].zip | 2011-12-05 12:42 | 122K | |
![[ ]](/icons/compressed.gif) | Atari Musicmaker (1989)(Music Sales).zip | 2011-12-05 12:42 | 123K | |
![[ ]](/icons/compressed.gif) | Becker CAD v1.25 (1989)(Data Becker)(fr).zip | 2011-12-05 12:42 | 123K | |
![[ ]](/icons/compressed.gif) | MicroEMACS v3.81 (1987-01-18)(-).zip | 2011-12-05 12:43 | 124K | |
![[ ]](/icons/compressed.gif) | Clocky v3.02F (19xx)(Stehlik, Petr).zip | 2011-12-05 12:42 | 124K | |
![[ ]](/icons/compressed.gif) | 1st Word Plus v1.89 (1986)(GST)(Disk 1 of 2).zip | 2011-12-05 12:42 | 125K | |
![[ ]](/icons/compressed.gif) | Exorcist Pro (1991)(Caledonia).zip | 2011-12-05 12:42 | 126K | |
![[ ]](/icons/compressed.gif) | Exorcist Pro (1991)(Caledonia)[cr].zip | 2011-12-05 12:42 | 126K | |
![[ ]](/icons/compressed.gif) | Home Publisher v1.2 (1987)(Hitec).zip | 2011-12-05 12:43 | 127K | |
![[ ]](/icons/compressed.gif) | Atari Mega STE Language Disk (1990)(Atari Corp.).zip | 2011-12-05 12:42 | 128K | |
![[ ]](/icons/compressed.gif) | PC-Ditto v3.64 (1988)(Avant-Garde Systems).zip | 2011-12-05 12:43 | 128K | |
![[ ]](/icons/compressed.gif) | Logitheque v2.3 (1989)(Laury, Philippe)(fr)(SW)[Bitz 194].zip | 2011-12-05 12:43 | 128K | |
![[ ]](/icons/compressed.gif) | Photolab v1.0 (1991)(Upgrade Editions)(fr)[monochrome].zip | 2011-12-05 12:43 | 129K | |
![[ ]](/icons/compressed.gif) | Photolab v1.0 (1991)(Upgrade Editions)(fr).zip | 2011-12-05 12:43 | 129K | |
![[ ]](/icons/compressed.gif) | Print Master Plus (1987)(Unison World).zip | 2011-12-05 12:43 | 129K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.6 (1991-05-06)(GFA Systemtechnik)[a2].zip | 2011-12-05 12:43 | 130K | |
![[ ]](/icons/compressed.gif) | Atari Language Disk 520ST (1985)(Atari Corp.).zip | 2011-12-05 12:42 | 130K | |
![[ ]](/icons/compressed.gif) | Magic v4.23 (1996-01-18)(Hellinger, Peter)(de)(FW).zip | 2011-12-05 12:43 | 132K | |
![[ ]](/icons/compressed.gif) | Grosses Tetes, Les (19xx)(Pressimage)(fr).zip | 2011-12-05 12:43 | 132K | |
![[ ]](/icons/compressed.gif) | Movie Master (1992)(Soft Bits).zip | 2011-12-05 12:43 | 132K | |
![[ ]](/icons/compressed.gif) | Deluxe Paint v1.0 (1990)(Electronic Arts)[m Noid].zip | 2011-12-05 12:42 | 132K | |
![[ ]](/icons/compressed.gif) | Neodesk v3.02 (19xx)(Gribnif)(fr)(Disk 2 of 2)[unregistered].zip | 2011-12-05 12:43 | 133K | |
![[ ]](/icons/compressed.gif) | Degas Elite v1.0 (1986)(Batteries Included).zip | 2011-12-05 12:42 | 133K | |
![[ ]](/icons/compressed.gif) | DB Man v2.02g (1995)(Versasoft)[b].zip | 2011-12-05 12:42 | 134K | |
![[ ]](/icons/compressed.gif) | Cuisine, La v1.50 (1991)(Hexagone)(fr)(Disk 3 of 3)[monochrome].zip | 2011-12-05 12:42 | 134K | |
![[ ]](/icons/compressed.gif) | InShape Modeler (demo) (19xx)(-)(Disk 2 of 2)[TT].zip | 2011-12-05 12:43 | 135K | |
![[ ]](/icons/compressed.gif) | Deluxe Paint v1.0 (1990)(Electronic Arts).zip | 2011-12-05 12:42 | 135K | |
![[ ]](/icons/compressed.gif) | Before Dawn v1.25 (1993)(Rudolph, Arne)(SW).zip | 2011-12-05 12:42 | 135K | |
![[ ]](/icons/compressed.gif) | 1st Word Plus v1.89 (1986)(GST)(Disk 2 of 2).zip | 2011-12-05 12:42 | 136K | |
![[ ]](/icons/compressed.gif) | Cookbook-On-Disk (1986)(CDA Electronic Publishing)[Chinese and Mexican Recipes].zip | 2011-12-05 12:42 | 136K | |
![[ ]](/icons/compressed.gif) | Gdos (19xx)(-)(Disk 3 of 6).zip | 2011-12-05 12:43 | 136K | |
![[ ]](/icons/compressed.gif) | Crazy Sounds v2.00c (1994)(Maxon).zip | 2011-12-05 12:42 | 136K | |
![[ ]](/icons/compressed.gif) | Deluxe Fontmaster ST v2.0 (1987)(Schiffler, Eckhard)(PD).zip | 2011-12-05 12:42 | 136K | |
![[ ]](/icons/compressed.gif) | Omikron Basic v3.0 (19xx)(Omikron).zip | 2011-12-05 12:43 | 136K | |
![[ ]](/icons/compressed.gif) | MS-Dos v3.2 (19xx)(Microsoft).zip | 2011-12-05 12:43 | 137K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.6 (1991-05-06)(GFA Systemtechnik)[a].zip | 2011-12-05 12:43 | 137K | |
![[ ]](/icons/compressed.gif) | Deluxe Fontmaster ST v2.0 (1987)(Schiffler, Eckhard)(PD)[a].zip | 2011-12-05 12:42 | 138K | |
![[ ]](/icons/compressed.gif) | CD-Tools v1.04 (1994-03-12)(Hard&Soft).zip | 2011-12-05 12:42 | 138K | |
![[ ]](/icons/compressed.gif) | Lasergraph Pro v2.50 (1991)(Bonnifet, S. - Guimberteau, P.)(Disk 3 of 6)(Disk Imagraph 1)[cr ICS].zip | 2011-12-05 12:43 | 139K | |
![[ ]](/icons/compressed.gif) | Alice - The Personal Pascal v1.5 (1987)(Looking Glass Software)(Disk 1 of 2).zip | 2011-12-05 12:42 | 140K | |
![[ ]](/icons/compressed.gif) | Disector v5.0 (19xx)(Evesham Micros).zip | 2011-12-05 12:42 | 141K | |
![[ ]](/icons/compressed.gif) | Freestyle (1993-08-22)(Sound Pool).zip | 2011-12-05 12:43 | 142K | |
![[ ]](/icons/compressed.gif) | AHDI v5.00 (1991-12-03)(Atari Corp.).zip | 2011-12-05 12:42 | 142K | |
![[ ]](/icons/compressed.gif) | Leo ST v1.0F (1991)(Micro Application & Data Becker)(fr)(Disk 2 of 2).zip | 2011-12-05 12:43 | 142K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v3.0 (1989)(Steinberg)(Disk 3 of 3)[cr MCA].zip | 2011-12-05 12:42 | 142K | |
![[ ]](/icons/compressed.gif) | Professional Mega Ripper (19xx)(Positivity).zip | 2011-12-05 12:43 | 142K | |
![[ ]](/icons/compressed.gif) | PC-Ditto v3.64 (1988)(Avant-Garde Systems)[a2].zip | 2011-12-05 12:43 | 142K | |
![[ ]](/icons/compressed.gif) | AHDI v5.00 (1991-12-03)(Atari Corp.)[a].zip | 2011-12-05 12:42 | 142K | |
![[ ]](/icons/compressed.gif) | Didot Professional v4.141 (1991)(3K Computerbild)(M3)(Disk 3 of 3)[cr Elite][copy to harddisk].zip | 2011-12-05 12:42 | 143K | |
![[ ]](/icons/compressed.gif) | Professional GEM (19xx)(-).zip | 2011-12-05 12:43 | 143K | |
![[ ]](/icons/compressed.gif) | Cookbook-On-Disk (1986)(CDA Electronic Publishing)[American and French Recipes].zip | 2011-12-05 12:42 | 144K | |
![[ ]](/icons/compressed.gif) | Audio Video Sequencer (1988)(Antic).zip | 2011-12-05 12:42 | 144K | |
![[ ]](/icons/compressed.gif) | Magic v4.90 (19xx)(Hellinger, Peter)(de)(FW).zip | 2011-12-05 12:43 | 144K | |
![[ ]](/icons/compressed.gif) | MIDI COM v3.9 (1993-10-22)(-).zip | 2011-12-05 12:43 | 145K | |
![[ ]](/icons/compressed.gif) | Omikron Basic v3.01 (1988)(Omikron)[a].zip | 2011-12-05 12:43 | 145K | |
![[ ]](/icons/compressed.gif) | MCS Songplayer (1987)(Intersect).zip | 2011-12-05 12:43 | 145K | |
![[ ]](/icons/compressed.gif) | Dali v3.01 (1989)(ACM)(Disk 1 of 2)[b].zip | 2011-12-05 12:42 | 146K | |
![[ ]](/icons/compressed.gif) | Omikron Basic v3.03 (19xx)(Omikron).zip | 2011-12-05 12:43 | 146K | |
![[ ]](/icons/compressed.gif) | Band-in-a-Box v4.2 (19xx)(PG Music)(Disk 2 of 2).zip | 2011-12-05 12:42 | 146K | |
![[ ]](/icons/compressed.gif) | Midia (1990)(C-Lab)(de)[cr MCA][monochrome].zip | 2011-12-05 12:43 | 146K | |
![[ ]](/icons/compressed.gif) | Laserbrain v1.42 (1992-10-21)(Garms, Klaus - Hansen, Pierre)(de).zip | 2011-12-05 12:43 | 147K | |
![[ ]](/icons/compressed.gif) | POV Docs, Scripts and Pictures (19xx)(-).zip | 2011-12-05 12:43 | 147K | |
![[ ]](/icons/compressed.gif) | Kuma Spreadsheet v4.07 (1990)(Kuma Computers Limited)(fr)(Disk 3 of 3).zip | 2011-12-05 12:43 | 147K | |
![[ ]](/icons/compressed.gif) | Flexidumb color v3.00 (1989)(Zitasoft).zip | 2011-12-05 12:43 | 147K | |
![[ ]](/icons/compressed.gif) | 1st Word Plus v2.02 (1986)(GST)(de)[Insert in B].zip | 2011-12-05 12:42 | 148K | |
![[ ]](/icons/compressed.gif) | Copiers 1 (19xx)(Misc).zip | 2011-12-05 12:42 | 148K | |
![[ ]](/icons/compressed.gif) | Magic v4.10 (1995-01-02)(Hellinger, Peter)(de)(FW)[a].zip | 2011-12-05 12:43 | 149K | |
![[ ]](/icons/compressed.gif) | Magic v4.10 (1995-01-02)(Hellinger, Peter)(de)(FW).zip | 2011-12-05 12:43 | 149K | |
![[ ]](/icons/compressed.gif) | Magic v4.10 (1995-01-02)(Hellinger, Peter)(de)(FW)[a2].zip | 2011-12-05 12:43 | 149K | |
![[ ]](/icons/compressed.gif) | Band-in-a-Box v4.2 (19xx)(PG Music)(Disk 1 of 2).zip | 2011-12-05 12:42 | 149K | |
![[ ]](/icons/compressed.gif) | Lattice C ST v5.60 (1993-11-08)(HiSoft)(Disk 7 of 7).zip | 2011-12-05 12:43 | 150K | |
![[ ]](/icons/compressed.gif) | Art Director (1988)(Epyx).zip | 2011-12-05 12:42 | 151K | |
![[ ]](/icons/compressed.gif) | Atari ST Language Disk (1985)(Atari Corp.)(de).zip | 2011-12-05 12:42 | 152K | |
![[ ]](/icons/compressed.gif) | Flash v1.60 (1986)(Antic).zip | 2011-12-05 12:43 | 152K | |
![[ ]](/icons/compressed.gif) | MusicMon (1991)(Galactic).zip | 2011-12-05 12:43 | 152K | |
![[ ]](/icons/compressed.gif) | D-Desk Soundeditor (1988)(Borst Pauwels, J.J.F.)[cr Elite].zip | 2011-12-05 12:42 | 152K | |
![[ ]](/icons/compressed.gif) | Chipmon II (1993)(Synergy).zip | 2011-12-05 12:42 | 155K | |
![[ ]](/icons/compressed.gif) | Aladin v1.3 (1987-05-31)(ProficomP)[cr Macintosh Enhancer][monochrome].zip | 2011-12-05 12:42 | 155K | |
![[ ]](/icons/compressed.gif) | Artis 4 - Prism Paint 2 (19xx)(16-32 Editions)(Disk 1 of 2)[cr IAAD Group].zip | 2011-12-05 12:42 | 156K | |
![[ ]](/icons/compressed.gif) | FANSI v1.00 (19xx)(-)[b].zip | 2011-12-05 12:42 | 156K | |
![[ ]](/icons/compressed.gif) | Eagles Intro Maker v1.0 (19xx)(J.P.S.)(Disk 2 of 2).zip | 2011-12-05 12:42 | 156K | |
![[ ]](/icons/compressed.gif) | Da Capo v1.22a (1995-09-06)(Dr. Francisco Mendez)[cr Phoenix].zip | 2011-12-05 12:42 | 157K | |
![[ ]](/icons/compressed.gif) | HiSoft Basic v2.10 (1992)(HiSoft)(Disk 3 of 3).zip | 2011-12-05 12:43 | 158K | |
![[ ]](/icons/compressed.gif) | HiSoft Basic v2.10 (1992)(HiSoft)(Disk 3 of 3)[cr Elite].zip | 2011-12-05 12:43 | 161K | |
![[ ]](/icons/compressed.gif) | GFA Assembleur (1989)(GFA Systemtechnik)(fr)[m Atariforce].zip | 2011-12-05 12:43 | 165K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.07 (19xx)(GFA Systemtechnik)(fr)[a].zip | 2011-12-05 12:43 | 165K | |
![[ ]](/icons/compressed.gif) | GFA Draft v2.0 (1986)(GFA Systemtechnik)(fr).zip | 2011-12-05 12:43 | 166K | |
![[ ]](/icons/compressed.gif) | Kandinsky v1.08 (1993-02-03)(Rossgoderer, Ulrich)(SW).zip | 2011-12-05 12:43 | 166K | |
![[ ]](/icons/compressed.gif) | Atari Language Disk Mega STE (19xx)(Atari Corp.).zip | 2011-12-05 12:42 | 167K | |
![[ ]](/icons/compressed.gif) | Brainbox (1988)(CRL Group)(Disk 1 of 2)[cr Powers That Be].zip | 2011-12-05 12:42 | 167K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 2 of 2)[cr MCA][a3].zip | 2011-12-05 12:42 | 167K | |
![[ ]](/icons/compressed.gif) | Notator v1.01 (1988)(Adam - Lengeling)[cr MCA].zip | 2011-12-05 12:43 | 168K | |
![[ ]](/icons/compressed.gif) | Notator v1.01 (1988)(Adam - Lengeling)[cr MCA][a].zip | 2011-12-05 12:43 | 168K | |
![[ ]](/icons/compressed.gif) | DatiST (19xx)(-)[b].zip | 2011-12-05 12:42 | 168K | |
![[ ]](/icons/compressed.gif) | Dali v3.01 (1989)(ACM)(Disk 2 of 2)[b].zip | 2011-12-05 12:42 | 168K | |
![[ ]](/icons/compressed.gif) | Master CAD v1.0 (1988)(Indi).zip | 2011-12-05 12:43 | 168K | |
![[ ]](/icons/compressed.gif) | Mega PCB v1.05 (1991-01)(Datentechnik, Rosin)(fr).zip | 2011-12-05 12:43 | 169K | |
![[ ]](/icons/compressed.gif) | GFA Artist (1987)(GFA Systemtechnik)[TOS 1.02].zip | 2011-12-05 12:43 | 169K | |
![[ ]](/icons/compressed.gif) | Falcon Language Disk (1992)(Atari Corp.).zip | 2011-12-05 12:42 | 170K | |
![[ ]](/icons/compressed.gif) | Band-in-a-Box v5.4 (19xx)(PG Music)(Disk 3 of 4).zip | 2011-12-05 12:42 | 170K | |
![[ ]](/icons/compressed.gif) | Cuisine, La (1991)(Hexagone)(fr)(Disk 2 of 3)[cr Replicants - ST Amigos].zip | 2011-12-05 12:42 | 170K | |
![[ ]](/icons/compressed.gif) | Band-in-a-Box v5.4 (19xx)(PG Music)(Disk 3 of 4)[a].zip | 2011-12-05 12:42 | 170K | |
![[ ]](/icons/compressed.gif) | Cookbook-On-Disk (1986)(CDA Electronic Publishing)[Italian Recipes].zip | 2011-12-05 12:42 | 171K | |
![[ ]](/icons/compressed.gif) | Degasart Part 1 v3.1 (1994)(Markotek)[b].zip | 2011-12-05 12:42 | 171K | |
![[ ]](/icons/compressed.gif) | Publishing Partner (19xx)(SoftLogic)[b].zip | 2011-12-05 12:43 | 174K | |
![[ ]](/icons/compressed.gif) | Neodesk v3.02 (19xx)(Gribnif)(fr)(Disk 1 of 2)[unregistered].zip | 2011-12-05 12:43 | 175K | |
![[ ]](/icons/compressed.gif) | Arranger Pro (19xx)(-)(fr)[cr MCA].zip | 2011-12-05 12:42 | 175K | |
![[ ]](/icons/compressed.gif) | Gdos (19xx)(-)(Disk 4 of 6).zip | 2011-12-05 12:43 | 175K | |
![[ ]](/icons/compressed.gif) | Compte Cheque v3 (1993)(Esat Software)(fr)[cr Replicants].zip | 2011-12-05 12:42 | 176K | |
![[ ]](/icons/compressed.gif) | Grafix (demo-playable) (19xx)(Goodmans International).zip | 2011-12-05 12:43 | 176K | |
![[ ]](/icons/compressed.gif) | Imagin v4.0d (1998-06-11)(Meier, Reinhard)(de)(FW).zip | 2011-12-05 12:43 | 176K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 2 of 2)[cr MCA][a2].zip | 2011-12-05 12:42 | 177K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 2 of 2)[cr MCA][a].zip | 2011-12-05 12:42 | 177K | |
![[ ]](/icons/compressed.gif) | HighSpeed Pascal v1.13 (1990)(Fihl, Christen - D-House)(Disk 2 of 2).zip | 2011-12-05 12:43 | 177K | |
![[ ]](/icons/compressed.gif) | Keyboard controlled Sequencer Level II v4.0 (1990-10-15)(Dr. T's Music Software)(Disk 2 of 2).zip | 2011-12-05 12:43 | 177K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 2 of 2).zip | 2011-12-05 12:42 | 177K | |
![[ ]](/icons/compressed.gif) | Emulcom v3.20 (1989-03)(Atari France)(fr).zip | 2011-12-05 12:42 | 178K | |
![[ ]](/icons/compressed.gif) | BeroPress ST v2.3 (1991)(Bero)(de)(PD).zip | 2011-12-05 12:42 | 179K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 2 of 2)[cr MCA][a4].zip | 2011-12-05 12:42 | 179K | |
![[ ]](/icons/compressed.gif) | Band-in-a-Box v5.4 (19xx)(PG Music)(Disk 1 of 4).zip | 2011-12-05 12:42 | 180K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v3.0 (1989)(Steinberg)(Disk 2 of 3)[cr MCA].zip | 2011-12-05 12:42 | 180K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.6TT (19xx)(GFA Systemtechnik)[b].zip | 2011-12-05 12:43 | 181K | |
![[ ]](/icons/compressed.gif) | Aladin Disk (19xx)(-)[a2].zip | 2011-12-05 12:42 | 181K | |
![[ ]](/icons/compressed.gif) | Midi Quest v1.01 (1990)(Sound Quest)(Disk 1 of 2).zip | 2011-12-05 12:43 | 183K | |
![[ ]](/icons/compressed.gif) | NEOchrome Master v2.24 (1991-04-29)(Chaos Inc.).zip | 2011-12-05 12:43 | 183K | |
![[ ]](/icons/compressed.gif) | Astrovie v1.00 (1987)(Prymac, Jean-Claude)(fr).zip | 2011-12-05 12:42 | 184K | |
![[ ]](/icons/compressed.gif) | Astrovie (1987)(Prymac, Jean-Claude)[cr Big Bang Chaos Computer Club de Bernay].zip | 2011-12-05 12:42 | 184K | |
![[ ]](/icons/compressed.gif) | Interface v2.00 (1992-08)(Shift)(fr).zip | 2011-12-05 12:43 | 185K | |
![[ ]](/icons/compressed.gif) | Creator v1.3 (1988)(C-Lab)[cr Ten Crew].zip | 2011-12-05 12:42 | 185K | |
![[ ]](/icons/compressed.gif) | Audio Sculpture (1991)(Synchron Assembly)[cr Fuzion].zip | 2011-12-05 12:42 | 186K | |
![[ ]](/icons/compressed.gif) | Cuisine, La (1991)(Hexagone)(fr)(Disk 3 of 3)[cr Replicants - ST Amigos].zip | 2011-12-05 12:42 | 186K | |
![[ ]](/icons/compressed.gif) | Dips v1.1 (1990-08)(Puch, Armin)(de)(FW).zip | 2011-12-05 12:42 | 187K | |
![[ ]](/icons/compressed.gif) | Atari Language Disk TT (19xx)(Atari Corp.).zip | 2011-12-05 12:42 | 188K | |
![[ ]](/icons/compressed.gif) | Master Tracks Pro v3.52 (1990)(Passport Designs).zip | 2011-12-05 12:43 | 188K | |
![[ ]](/icons/compressed.gif) | Megatizer v2.3 (1992)(Sector One).zip | 2011-12-05 12:43 | 188K | |
![[ ]](/icons/compressed.gif) | Protracker ST v2.0 (19xx)(Oygard, Karl Anders - Runde, Hans Arild)(SW).zip | 2011-12-05 12:43 | 190K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v3.01 (1992)(Steinberg)(Disk 2 of 3)[a].zip | 2011-12-05 12:42 | 190K | |
![[ ]](/icons/compressed.gif) | Becker Design v1.00d (1991)(Data Becker)(de)(Disk 2 of 2).zip | 2011-12-05 12:42 | 192K | |
![[ ]](/icons/compressed.gif) | Band-in-a-Box v5.4 (19xx)(PG Music)(Disk 2 of 4).zip | 2011-12-05 12:42 | 193K | |
![[ ]](/icons/compressed.gif) | Megamax C (1986)(MegaMax)[b].zip | 2011-12-05 12:43 | 193K | |
![[ ]](/icons/compressed.gif) | MegaPaint v2.00 (1989)(TommySoftware)[b].zip | 2011-12-05 12:43 | 193K | |
![[ ]](/icons/compressed.gif) | Beckertext ST v1.0 (1987)(Data Becker)(fr).zip | 2011-12-05 12:42 | 194K | |
![[ ]](/icons/compressed.gif) | Proscore v1.0 (1989-05)(Comus)(fr).zip | 2011-12-05 12:43 | 194K | |
![[ ]](/icons/compressed.gif) | Copiers 4 (19xx)(Misc).zip | 2011-12-05 12:42 | 195K | |
![[ ]](/icons/compressed.gif) | Band-in-a-Box v5.4 (19xx)(PG Music)(Disk 4 of 4).zip | 2011-12-05 12:42 | 196K | |
![[ ]](/icons/compressed.gif) | Deluxe Paint Animation Converter v1.0 (1990)(ArtisTech Development).zip | 2011-12-05 12:42 | 196K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 2 of 2)[cr MCA].zip | 2011-12-05 12:42 | 197K | |
![[ ]](/icons/compressed.gif) | Eureka v4.04 (1987-02)(Archimedium).zip | 2011-12-05 12:42 | 197K | |
![[ ]](/icons/compressed.gif) | Intro Construction Set, The (19xx)(Lord Grahl)(de).zip | 2011-12-05 12:43 | 197K | |
![[ ]](/icons/compressed.gif) | Lattice C (19xx)(Hisoft).zip | 2011-12-05 12:43 | 197K | |
![[ ]](/icons/compressed.gif) | Intro Construction Set (19xx)(Kyriela).zip | 2011-12-05 12:43 | 198K | |
![[ ]](/icons/compressed.gif) | Computereyes v1.12 (1987)(Digital Vision).zip | 2011-12-05 12:42 | 198K | |
![[ ]](/icons/compressed.gif) | GFA Basic Companion (1987)(MichTron).zip | 2011-12-05 12:43 | 198K | |
![[ ]](/icons/compressed.gif) | Platon (1990)(VHF)(de)(Disk 2 of 2)[cr].zip | 2011-12-05 12:43 | 198K | |
![[ ]](/icons/compressed.gif) | Megatizer v2.4 (1992-04-13)(Sector One)[a2].zip | 2011-12-05 12:43 | 198K | |
![[ ]](/icons/compressed.gif) | Man in the Middle is Dead, The (19xx)(-).zip | 2011-12-05 12:43 | 200K | |
![[ ]](/icons/compressed.gif) | Aladin v1.3 (1987-05-31)(ProficomP)(de)[cr Alyssa].zip | 2011-12-05 12:42 | 200K | |
![[ ]](/icons/compressed.gif) | Lattice C ST v5.60 (1993-11-08)(HiSoft)(Disk 3 of 7).zip | 2011-12-05 12:43 | 200K | |
![[ ]](/icons/compressed.gif) | Discovery Cartridge Tools (1988)(Happy Computer).zip | 2011-12-05 12:42 | 200K | |
![[ ]](/icons/compressed.gif) | Chronos 3D Key Frame Animator v1.0 (1991-04-15)(Dana, Paul)(Disk 1 of 4)[b].zip | 2011-12-05 12:42 | 200K | |
![[ ]](/icons/compressed.gif) | Propulse (demo-playable) (1987)(Flem - Propulse - Atari Corp.).zip | 2011-12-05 12:43 | 201K | |
![[ ]](/icons/compressed.gif) | Mocao (19xx)(-).zip | 2011-12-05 12:42 | 201K | |
![[ ]](/icons/compressed.gif) | CyberTexture (1989)(Antic).zip | 2011-12-05 12:42 | 202K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v3.01 (19xx)(Steinberg)(Disk 2 of 3).zip | 2011-12-05 12:42 | 202K | |
![[ ]](/icons/compressed.gif) | Freestyle Pro (1992-01-09)(Sound Pool)(Disk 2 of 2)[cr Elite].zip | 2011-12-05 12:42 | 202K | |
![[ ]](/icons/compressed.gif) | Band-in-a-Box v5.4 (19xx)(PG Music)(Disk 2 of 4)[a].zip | 2011-12-05 12:42 | 203K | |
![[ ]](/icons/compressed.gif) | Letters Kit (1990-12-26)(Sergent).zip | 2011-12-05 12:43 | 203K | |
![[ ]](/icons/compressed.gif) | DA's Vektor v1.2 (1993-01-24)(Digital Arts)(de)(Disk 5 of 7).zip | 2011-12-05 12:42 | 203K | |
![[ ]](/icons/compressed.gif) | Feeling Partner v1.6 (1992-03-29)(Dubois, JC).zip | 2011-12-05 12:42 | 204K | |
![[ ]](/icons/compressed.gif) | EZ-Score Plus v1.1 (2000-05)(Bajoras, Tom)(FW).zip | 2011-12-05 12:42 | 204K | |
![[ ]](/icons/compressed.gif) | Chemcalc v2.0 (19xx)(Buchen, Lothar)(de).zip | 2011-12-05 12:42 | 204K | |
![[ ]](/icons/compressed.gif) | Geocad (1996-11)(Stratmann, Benedikt)(de)(Disk 2 of 2).zip | 2011-12-05 12:43 | 204K | |
![[ ]](/icons/compressed.gif) | Hyper Paint (1988)(Atari Corp.)[needs GDOS].zip | 2011-12-05 12:43 | 206K | |
![[ ]](/icons/compressed.gif) | Deluxe Paint ST Viewer v1.0 (1990)(Electronic Arts).zip | 2011-12-05 12:42 | 206K | |
![[ ]](/icons/compressed.gif) | Original Atari ST Cheat Disk v1.3r, The (1990)(K.M.E.).zip | 2011-12-05 12:43 | 206K | |
![[ ]](/icons/compressed.gif) | Arranger ST v2.0 (1990)(Zadok Products)(Disk 1 of 2)[cr Elite].zip | 2011-12-05 12:42 | 207K | |
![[ ]](/icons/compressed.gif) | GDPS (1991)(TMS)(de).zip | 2011-12-05 12:43 | 207K | |
![[ ]](/icons/compressed.gif) | Adimens ST v2.3 (1988)(ADI)[a].zip | 2011-12-05 12:42 | 208K | |
![[ ]](/icons/compressed.gif) | Degas Elite v1.0 (1986)(Batteries Included)[a2].zip | 2011-12-05 12:42 | 208K | |
![[ ]](/icons/compressed.gif) | Adimens ST v2.3 (1988)(ADI).zip | 2011-12-05 12:42 | 209K | |
![[ ]](/icons/compressed.gif) | Kappellmeister v1 (19xx)(-)[b].zip | 2011-12-05 12:43 | 209K | |
![[ ]](/icons/compressed.gif) | GEM - CALC plus v3.60 (1992)(Maxon)(de)[b].zip | 2011-12-05 12:43 | 209K | |
![[ ]](/icons/compressed.gif) | Graphologue, Le (1991)(Uranie Software)(fr).zip | 2011-12-05 12:43 | 210K | |
![[ ]](/icons/compressed.gif) | Gdos (19xx)(-)(Disk 6 of 6).zip | 2011-12-05 12:43 | 211K | |
![[ ]](/icons/compressed.gif) | Megamax Resource Construction Program (1986)(Megamax).zip | 2011-12-05 12:43 | 212K | |
![[ ]](/icons/compressed.gif) | Cuisine, La (1991)(Hexagone)(fr)(Disk 1 of 3)[cr Replicants - ST Amigos].zip | 2011-12-05 12:42 | 212K | |
![[ ]](/icons/compressed.gif) | Modula 2 v3.00 (19xx)(-)[a].zip | 2011-12-05 12:43 | 213K | |
![[ ]](/icons/compressed.gif) | Band-in-a-Box v5.4 (19xx)(PG Music)(Disk 4 of 4)[a].zip | 2011-12-05 12:42 | 214K | |
![[ ]](/icons/compressed.gif) | Edith Pro v1.221 (1996-05-10)(ZFC).zip | 2011-12-05 12:42 | 214K | |
![[ ]](/icons/compressed.gif) | GFA Expert (1990)(Kempen, Han)[a].zip | 2011-12-05 12:43 | 215K | |
![[ ]](/icons/compressed.gif) | GFA Expert (1990)(Kempen, Han).zip | 2011-12-05 12:43 | 215K | |
![[ ]](/icons/compressed.gif) | Graphologue, Le (1991)(Uranie Software)(fr)[monochrome].zip | 2011-12-05 12:43 | 215K | |
![[ ]](/icons/compressed.gif) | Astrocycle Senior v1.40 (1990)(Prymac, Jean-Claude)(fr).zip | 2011-12-05 12:42 | 215K | |
![[ ]](/icons/compressed.gif) | FreeMiNT v1.14 Beta (1996-09-21)(Istari Software).zip | 2011-12-05 12:43 | 216K | |
![[ ]](/icons/compressed.gif) | BigBoss 24 v3 (1992-09)(Rythm'n Soft)[cr MCA].zip | 2011-12-05 12:42 | 216K | |
![[ ]](/icons/compressed.gif) | BigBoss24 v3.0 (1999-09)(Rythm'n Software)(M3)[cr Elite].zip | 2011-12-05 12:42 | 216K | |
![[ ]](/icons/compressed.gif) | GFA Basic v1.0 (1986)(GFA Systemtechnik) & Logo (19xx)(Atari Corp.).zip | 2011-12-05 12:43 | 217K | |
![[ ]](/icons/compressed.gif) | Crack Art (1991-10-20)(Borchers, Jan - Ruttger, Detlef)(SW).zip | 2011-12-05 12:42 | 217K | |
![[ ]](/icons/compressed.gif) | Megatizer v2.4 (1992-04-13)(Sector One).zip | 2011-12-05 12:43 | 217K | |
![[ ]](/icons/compressed.gif) | Modula 2 (19xx)(-).zip | 2011-12-05 12:43 | 218K | |
![[ ]](/icons/compressed.gif) | 3D Calc+ v2.3 (19xx)(Schoonjans, Frank)(fr).zip | 2011-12-05 12:42 | 218K | |
![[ ]](/icons/compressed.gif) | Cuisine, La v1.50 (1991)(Hexagone)(fr)(Disk 2 of 3)[monochrome].zip | 2011-12-05 12:42 | 219K | |
![[ ]](/icons/compressed.gif) | Calligrapher vPR2.10COPY (1990)(Eclectron)(fr)(Disk 1 of 2).zip | 2011-12-05 12:42 | 219K | |
![[ ]](/icons/compressed.gif) | Adimens ST v2.1 (1987)(ADI)[a].zip | 2011-12-05 12:42 | 219K | |
![[ ]](/icons/compressed.gif) | Graal Base v1 (1989)(Editions Profil)(fr)(Disk 2 of 2).zip | 2011-12-05 12:43 | 219K | |
![[ ]](/icons/compressed.gif) | Maps and Legends - The Cartographer v2.0 (1986)(Antic).zip | 2011-12-05 12:43 | 220K | |
![[ ]](/icons/compressed.gif) | Noise Tracker v1.5 (19xx)(-)[b].zip | 2011-12-05 12:43 | 221K | |
![[ ]](/icons/compressed.gif) | Alice - The Personal Pascal v1.5 (1987)(Looking Glass Software)(Disk 2 of 2).zip | 2011-12-05 12:42 | 221K | |
![[ ]](/icons/compressed.gif) | Disector v5.0 (19xx)(Evesham Micros)[a].zip | 2011-12-05 12:42 | 221K | |
![[ ]](/icons/compressed.gif) | Easy Text (19xx)(-)[u].zip | 2011-12-05 12:42 | 222K | |
![[ ]](/icons/compressed.gif) | Gdos (19xx)(-)(Disk 1 of 6).zip | 2011-12-05 12:43 | 223K | |
![[ ]](/icons/compressed.gif) | Maxidat v5.23 (1996-09-11)(Heinrich, Alexander)(de)[Testversion].zip | 2011-12-05 12:43 | 224K | |
![[ ]](/icons/compressed.gif) | Lattice C ST v5.60 (1993-11-08)(HiSoft)(Disk 4 of 7).zip | 2011-12-05 12:43 | 224K | |
![[ ]](/icons/compressed.gif) | HiSoft Basic v2.10 (1992)(HiSoft)(Disk 2 of 3).zip | 2011-12-05 12:43 | 224K | |
![[ ]](/icons/compressed.gif) | LDW Power v2.00 (1990)(Logical Design Works)[a2].zip | 2011-12-05 12:43 | 225K | |
![[ ]](/icons/compressed.gif) | Background Sound Programm (19xx)(-).zip | 2011-12-05 12:42 | 225K | |
![[ ]](/icons/compressed.gif) | Lattice C ST v5.60 (1993-11-08)(HiSoft)(Disk 5 of 7).zip | 2011-12-05 12:43 | 226K | |
![[ ]](/icons/compressed.gif) | Atari Works v1.207 (1993-07-22)(STP Electronics Ltd.)(fr)[needs GDOS].zip | 2011-12-05 12:42 | 226K | |
![[ ]](/icons/compressed.gif) | BigBoss v1.0 (1991-01)(Rythm'n Soft)(M3)[monochrome].zip | 2011-12-05 12:42 | 226K | |
![[ ]](/icons/compressed.gif) | Adimens ST v2.1 (1987)(ADI).zip | 2011-12-05 12:42 | 227K | |
![[ ]](/icons/compressed.gif) | Aladin Disk (19xx)(-)[a].zip | 2011-12-05 12:42 | 227K | |
![[ ]](/icons/compressed.gif) | BigBoss v1.0 (1991-01)(Rythm'n Soft)(M3)[a][monochrome].zip | 2011-12-05 12:42 | 228K | |
![[ ]](/icons/compressed.gif) | Avalon v1.0 (19xx)(Steinberg)(STE)(de)[cr MCA].zip | 2011-12-05 12:42 | 228K | |
![[ ]](/icons/compressed.gif) | Keyboard controlled Sequencer Level II v4.0 (1990-10-15)(Dr. T's Music Software)(Disk 1 of 2).zip | 2011-12-05 12:43 | 229K | |
![[ ]](/icons/compressed.gif) | Atari Works v1.207 (1993-07-22)(STP Electronics Ltd.)(fr)[h AtariCD][needs GDOS].zip | 2011-12-05 12:42 | 229K | |
![[ ]](/icons/compressed.gif) | Cyberpaint v2.00 (1988)(Antic).zip | 2011-12-05 12:42 | 229K | |
![[ ]](/icons/compressed.gif) | Copiers 3 (19xx)(Misc).zip | 2011-12-05 12:42 | 230K | |
![[ ]](/icons/compressed.gif) | NoSys 100 (19xx)(No!)(de).zip | 2011-12-05 12:43 | 230K | |
![[ ]](/icons/compressed.gif) | Lasergraph Pro v2.50 (1991)(Bonnifet, S. - Guimberteau, P.)(Disk 1 of 6)[cr ICS].zip | 2011-12-05 12:43 | 231K | |
![[ ]](/icons/compressed.gif) | OVR Compil Code (19xx)(OVR).zip | 2011-12-05 12:43 | 231K | |
![[ ]](/icons/compressed.gif) | HiSoft Basic v2.10 (1992)(HiSoft)(Disk 2 of 3)[cr Elite].zip | 2011-12-05 12:43 | 232K | |
![[ ]](/icons/compressed.gif) | HighSpeed Pascal v1.13 (1990)(Fihl, Christen - D-House)(Disk 1 of 2).zip | 2011-12-05 12:43 | 232K | |
![[ ]](/icons/compressed.gif) | 3D Construction Kit, The v1.20 (1991)(Domark)(M4)[a].zip | 2011-12-05 12:42 | 232K | |
![[ ]](/icons/compressed.gif) | 3D Construction Kit, The v1.20 (1991)(Domark)(M4).zip | 2011-12-05 12:42 | 232K | |
![[ ]](/icons/compressed.gif) | 3D Construction Kit, The v1.20 (1991)(Domark)(M4)[m Zorro II].zip | 2011-12-05 12:42 | 232K | |
![[ ]](/icons/compressed.gif) | Diamond Edge v2.04 (1994)(Oregon Research)[registered].zip | 2011-12-05 12:42 | 234K | |
![[ ]](/icons/compressed.gif) | 1st Word Plus v2.02 (1986)(GST)(de).zip | 2011-12-05 12:42 | 235K | |
![[ ]](/icons/compressed.gif) | DA's Vektor v1.2 (1993-01-24)(Digital Arts)(de)(Disk 1 of 7).zip | 2011-12-05 12:42 | 235K | |
![[ ]](/icons/compressed.gif) | Jazz Guitarist v1.0 (1993)(PG Music)(Disk 1 of 3).zip | 2011-12-05 12:43 | 236K | |
![[ ]](/icons/compressed.gif) | 3D Construction Kit, The (1991)(Domark)(M4)[cr Replicants - ST Amigos][b].zip | 2011-12-05 12:42 | 237K | |
![[ ]](/icons/compressed.gif) | Neodesk v2.02 (1989-01-24)(Gribnif).zip | 2011-12-05 12:43 | 237K | |
![[ ]](/icons/compressed.gif) | Page Stream v2.1 (1991)(Soft-Logik Publishing)(Disk 2 of 4).zip | 2011-12-05 12:43 | 239K | |
![[ ]](/icons/compressed.gif) | Programming Language Installation Disk (19xx)(-)(fr).zip | 2011-12-05 12:43 | 239K | |
![[ ]](/icons/compressed.gif) | Encore v1.35 (1990)(Passport Designs)(Disk 1 of 3).zip | 2011-12-05 12:42 | 239K | |
![[ ]](/icons/compressed.gif) | Artis 3 (19xx)(Artis Software)[b].zip | 2011-12-05 12:42 | 240K | |
![[ ]](/icons/compressed.gif) | COMA v2.00 (1994-04-30)(Softbaer GbR)(de-en)(SW).zip | 2011-12-05 12:42 | 240K | |
![[ ]](/icons/compressed.gif) | Diamond Back II v2.50 (1992)(Oregon Research)[a].zip | 2011-12-05 12:42 | 240K | |
![[ ]](/icons/compressed.gif) | Diamond Back II v2.50 (1992)(Oregon Research).zip | 2011-12-05 12:42 | 240K | |
![[ ]](/icons/compressed.gif) | Cuisine, La v1.50 (1991)(Hexagone)(fr)(Disk 1 of 3)[monochrome].zip | 2011-12-05 12:42 | 242K | |
![[ ]](/icons/compressed.gif) | Lattice C ST v5.60 (1993-11-08)(HiSoft)(Disk 6 of 7).zip | 2011-12-05 12:43 | 242K | |
![[ ]](/icons/compressed.gif) | Discovery Cartridge Tools (1988)(Happy Computer)[a].zip | 2011-12-05 12:42 | 243K | |
![[ ]](/icons/compressed.gif) | Lasergraph Pro v2.50 (1991)(Bonnifet, S. - Guimberteau, P.)(Disk 6 of 6)(Disk Imagraph 4)[cr ICS].zip | 2011-12-05 12:43 | 244K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.6 (1991-04-18)(GFA Systemtechnik)(de).zip | 2011-12-05 12:43 | 244K | |
![[ ]](/icons/compressed.gif) | GFA-Draft plus v3.13 (1988)(Kress - Magengast).zip | 2011-12-05 12:43 | 245K | |
![[ ]](/icons/compressed.gif) | Haba View v1.0 (1986)(Williams, Woody).zip | 2011-12-05 12:43 | 245K | |
![[ ]](/icons/compressed.gif) | Graal Base v1 (1989)(Editions Profil)(fr)(Disk 1 of 2).zip | 2011-12-05 12:43 | 245K | |
![[ ]](/icons/compressed.gif) | Gdos (19xx)(-)(Disk 2 of 6).zip | 2011-12-05 12:43 | 245K | |
![[ ]](/icons/compressed.gif) | FoReM ST v2.2 (1988)(Singer, Matthew R.).zip | 2011-12-05 12:43 | 247K | |
![[ ]](/icons/compressed.gif) | Er was eens... (19xx)(-)[cr MCA].zip | 2011-12-05 12:42 | 247K | |
![[ ]](/icons/compressed.gif) | Page Assistant v1.05 (1992)(Spar Systems).zip | 2011-12-05 12:43 | 249K | |
![[ ]](/icons/compressed.gif) | Phaleon Illusion Screen Source (1992)(Next).zip | 2011-12-05 12:43 | 249K | |
![[ ]](/icons/compressed.gif) | Phaleon Illusion Screen Source (1992)(Next)[a].zip | 2011-12-05 12:43 | 249K | |
![[ ]](/icons/compressed.gif) | Pro Tracker ST v2.0s (1993)(Clever Bits)(SW).zip | 2011-12-05 12:43 | 250K | |
![[ ]](/icons/compressed.gif) | Compta, La v1.01 (1986)(Beaumont Gestion - Memsoft)(fr).zip | 2011-12-05 12:42 | 250K | |
![[ ]](/icons/compressed.gif) | 1st Word Plus v3.20 (1991)(GST).zip | 2011-12-05 12:42 | 251K | |
![[ ]](/icons/compressed.gif) | Herschel - l'atlas du ciel v2.7 (19xx)(Bailly, D.)(fr)[high res only].zip | 2011-12-05 12:43 | 251K | |
![[ ]](/icons/compressed.gif) | Atari Works v1.207 (1993-07-22)(STP Electronics Ltd.)(Disk 1 of 3).zip | 2011-12-05 12:42 | 252K | |
![[ ]](/icons/compressed.gif) | Adimens ST v2.1 (1987)(ADI)[a2].zip | 2011-12-05 12:42 | 252K | |
![[ ]](/icons/compressed.gif) | Artwork (19xx)(Misc).zip | 2011-12-05 12:42 | 252K | |
![[ ]](/icons/compressed.gif) | MiNT v7.9 (1992-0-08)(Atari Corp.)(Disk 3 of 3).zip | 2011-12-05 12:43 | 253K | |
![[ ]](/icons/compressed.gif) | InShape Modeler (demo) (19xx)(-)(Disk 1 of 2)[TT].zip | 2011-12-05 12:43 | 253K | |
![[ ]](/icons/compressed.gif) | 1st Word Plus v3.20 (1992)(GST)(fr)[m Megaforce].zip | 2011-12-05 12:42 | 253K | |
![[ ]](/icons/compressed.gif) | POV 2 v1.32 (1993-10-16)(-)(Disk 3 of 3).zip | 2011-12-05 12:43 | 254K | |
![[ ]](/icons/compressed.gif) | ICD Pro Festplattentreiber v5.42 (1991)(ICD Inc.)(de).zip | 2011-12-05 12:43 | 255K | |
![[ ]](/icons/compressed.gif) | Numeroscope v1.2 (1988)(Prymac, Jean-Claude)(fr)(PD).zip | 2011-12-05 12:43 | 255K | |
![[ ]](/icons/compressed.gif) | Devpac TT v3.02 (1991-08-06)(HiSoft).zip | 2011-12-05 12:42 | 258K | |
![[ ]](/icons/compressed.gif) | CompoScript v1.0 (1991)(Compo Software - Lincoln)(Disk 1 of 4).zip | 2011-12-05 12:42 | 259K | |
![[ ]](/icons/compressed.gif) | Platon (1990)(VHF)(de)(Disk 1 of 2)[cr].zip | 2011-12-05 12:43 | 259K | |
![[ ]](/icons/compressed.gif) | Kuma Spreadsheet v4.07 (1990)(Kuma Computers Limited)(fr)(Disk 2 of 3).zip | 2011-12-05 12:43 | 260K | |
![[ ]](/icons/compressed.gif) | EZ-Score Plus v1.0 (1987)(Hybrid Arts)[cr SDI].zip | 2011-12-05 12:42 | 260K | |
![[ ]](/icons/compressed.gif) | Cubase Utility Disk (19xx)(Steinberg).zip | 2011-12-05 12:42 | 260K | |
![[ ]](/icons/compressed.gif) | Gemini v1.1 (1990-04-11)(Eissing, Stefan - Gereon Steffens)(SW).zip | 2011-12-05 12:43 | 261K | |
![[ ]](/icons/compressed.gif) | ExtenDOS Pro v2.4 (1996)(Burrows, Roger).zip | 2011-12-05 12:42 | 262K | |
![[ ]](/icons/compressed.gif) | Atari Image Manager v3.00 (1991-03-25)(TU Delft)(PD)[Bitz 210].zip | 2011-12-05 12:42 | 262K | |
![[ ]](/icons/compressed.gif) | Degasart Part 3 v3.2 (1994)(Markotek).zip | 2011-12-05 12:42 | 263K | |
![[ ]](/icons/compressed.gif) | Gemini v1.1 (1990-04-11)(Eissing, Stefan - Gereon Steffens)(SW)[b].zip | 2011-12-05 12:43 | 263K | |
![[ ]](/icons/compressed.gif) | Modula 2 v3.00 (19xx)(-).zip | 2011-12-05 12:43 | 263K | |
![[ ]](/icons/compressed.gif) | NEOchrome v1.0 (19xx)(Chaos Inc.).zip | 2011-12-05 12:43 | 263K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v1.51 (1989)(Steinberg)[cr MCA].zip | 2011-12-05 12:42 | 264K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v1.51 (1989)(Steinberg)[cr MCA][a].zip | 2011-12-05 12:42 | 264K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v1.51 (1989)(Steinberg)[cr MCA][a2].zip | 2011-12-05 12:42 | 264K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.6TT (19xx)(GFA Systemtechnik).zip | 2011-12-05 12:43 | 264K | |
![[ ]](/icons/compressed.gif) | Atari Works (19xx)(STP Electronics Ltd.)(fr)[b2].zip | 2011-12-05 12:42 | 265K | |
![[ ]](/icons/compressed.gif) | Edith (1994)(ZFC).zip | 2011-12-05 12:42 | 266K | |
![[ ]](/icons/compressed.gif) | Data Manager Professional v1.1a (1988)(Talent Computer Systems).zip | 2011-12-05 12:42 | 268K | |
![[ ]](/icons/compressed.gif) | Astro - Programm des Lebens v5.0 (1986)(Biosystems)(de).zip | 2011-12-05 12:42 | 269K | |
![[ ]](/icons/compressed.gif) | Freedom v1.15e (demo-playable) (1995-10-28)(Krueger, Christian - Kolja Koischwitz).zip | 2011-12-05 12:43 | 270K | |
![[ ]](/icons/compressed.gif) | Imagin v4.0a (demo-playable) (1997-09-22)(Meier, Reinhard)(de).zip | 2011-12-05 12:43 | 271K | |
![[ ]](/icons/compressed.gif) | CAB v1.0a (1995-12)(Clauss, Alexander)(STE)(FW)[a].zip | 2011-12-05 12:42 | 271K | |
![[ ]](/icons/compressed.gif) | Loader Construction Kit v1.93F (1993-07-05)(Pixel Boys)(fr)[m AtariCD].zip | 2011-12-05 12:43 | 271K | |
![[ ]](/icons/compressed.gif) | Loader Construction Kit v1.93F (1993-07-05)(Pixel Boys)(fr)[m Boot Zorro II].zip | 2011-12-05 12:43 | 272K | |
![[ ]](/icons/compressed.gif) | CAB v1.0a (1995-12)(Clauss, Alexander)(STE)(FW).zip | 2011-12-05 12:42 | 272K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.6 (1991-05-06)(GFA Systemtechnik).zip | 2011-12-05 12:43 | 272K | |
![[ ]](/icons/compressed.gif) | Degasart Part 2 v3.1 (1994)(Markotek).zip | 2011-12-05 12:42 | 273K | |
![[ ]](/icons/compressed.gif) | Dali Light (1989)(ACM).zip | 2011-12-05 12:42 | 273K | |
![[ ]](/icons/compressed.gif) | CAD-3D v2.02 (1987)(Exclusive Distribution).zip | 2011-12-05 12:42 | 273K | |
![[ ]](/icons/compressed.gif) | Omikron Basic v2.2 (19xx)(Omikron).zip | 2011-12-05 12:43 | 275K | |
![[ ]](/icons/compressed.gif) | Demo Construction Kit (1991)(Eurosoft)(fr)(Disk 2 of 3)[cr Elite][m Megatari].zip | 2011-12-05 12:42 | 278K | |
![[ ]](/icons/compressed.gif) | Demo Construction Kit (1992)(Eurosoft)(fr)(Disk 2 of 3)[a].zip | 2011-12-05 12:42 | 279K | |
![[ ]](/icons/compressed.gif) | Platon v2.1 (1991-02-19)(VHF)(de)(Disk 2 of 3)[cr].zip | 2011-12-05 12:43 | 279K | |
![[ ]](/icons/compressed.gif) | Overlay v0.10.3 (demo-playable) (1993)(OverScan)(Disk 2 of 3).zip | 2011-12-05 12:43 | 279K | |
![[ ]](/icons/compressed.gif) | Arabesque Professional (19xx)(-).zip | 2011-12-05 12:42 | 280K | |
![[ ]](/icons/compressed.gif) | Demo Construction Kit (1992)(Eurosoft)(fr)(Disk 2 of 3).zip | 2011-12-05 12:42 | 280K | |
![[ ]](/icons/compressed.gif) | Geneva 4 (1991)(Gribnif)(Disk 2 of 2).zip | 2011-12-05 12:43 | 280K | |
![[ ]](/icons/compressed.gif) | Aladin v1.3 (1987-05-31)(ProficomP)(de).zip | 2011-12-05 12:42 | 281K | |
![[ ]](/icons/compressed.gif) | Font Disk 2 (19xx)(Lord of Doom).zip | 2011-12-05 12:43 | 281K | |
![[ ]](/icons/compressed.gif) | MultiTOS (1993)(Atari Corp.).zip | 2011-12-05 12:43 | 282K | |
![[ ]](/icons/compressed.gif) | DA's Vektor Pro v2.0 (1993-09-28)(Digital Arts)(Disk 1 of 2).zip | 2011-12-05 12:42 | 282K | |
![[ ]](/icons/compressed.gif) | Charly Image v2.00 (1992)(Mikroelektronik, Wilhelm)(de)(Disk 2 of 2).zip | 2011-12-05 12:42 | 285K | |
![[ ]](/icons/compressed.gif) | Easy Text Professional v1.06 (1992)(zzSoft).zip | 2011-12-05 12:42 | 286K | |
![[ ]](/icons/compressed.gif) | Prism Paint v1.0 (1991)(Lexicor Software)(Disk 1 of 3).zip | 2011-12-05 12:43 | 286K | |
![[ ]](/icons/compressed.gif) | Chronos 3D Key Frame Animator v1.0 (1991-04-15)(Dana, Paul)(Disk 2 of 4)[b].zip | 2011-12-05 12:42 | 288K | |
![[ ]](/icons/compressed.gif) | Film Director (1988)(Epyx).zip | 2011-12-05 12:43 | 288K | |
![[ ]](/icons/compressed.gif) | Artis 4 - Prism Paint 2 (19xx)(16-32 Editions)(Disk 2 of 2)[cr IAAD Group].zip | 2011-12-05 12:42 | 289K | |
![[ ]](/icons/compressed.gif) | DA's Vektor v1.2 (1993-01-24)(Digital Arts)(de)(Disk 2 of 7).zip | 2011-12-05 12:42 | 289K | |
![[ ]](/icons/compressed.gif) | Doctorin' the House (1988)(An Cool).zip | 2011-12-05 12:42 | 290K | |
![[ ]](/icons/compressed.gif) | Eagles Intro Maker v1.0 (19xx)(J.P.S.)(Disk 1 of 2).zip | 2011-12-05 12:42 | 291K | |
![[ ]](/icons/compressed.gif) | MROS Switcher v3.02 (1989)(Steinberg).zip | 2011-12-05 12:43 | 291K | |
![[ ]](/icons/compressed.gif) | Harlekin III (1993-03-12)(HiSoft)[a].zip | 2011-12-05 12:43 | 293K | |
![[ ]](/icons/compressed.gif) | Digit Tracker (1992)(Galactic)(Disk 1 of 3).zip | 2011-12-05 12:42 | 293K | |
![[ ]](/icons/compressed.gif) | Encore v1.35 (1990)(Passport Designs)(Disk 2 of 3).zip | 2011-12-05 12:42 | 294K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.51 (19xx)(GFA Systemtechnik).zip | 2011-12-05 12:43 | 295K | |
![[ ]](/icons/compressed.gif) | Newdesk (1988)(Atari Corp.)(fr).zip | 2011-12-05 12:43 | 295K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.5 (19xx)(GFA Systemtechnik).zip | 2011-12-05 12:43 | 295K | |
![[ ]](/icons/compressed.gif) | MultiTOS (1993)(Atari Corp.)(fr)[a].zip | 2011-12-05 12:43 | 295K | |
![[ ]](/icons/compressed.gif) | Geocad (1996-11)(Stratmann, Benedikt)(de)(Disk 1 of 2).zip | 2011-12-05 12:43 | 297K | |
![[ ]](/icons/compressed.gif) | Calligrapher vPR2.10COPY (1990)(Eclectron)(fr)(Disk 2 of 2).zip | 2011-12-05 12:42 | 299K | |
![[ ]](/icons/compressed.gif) | Eikona v2.04 (1993-10-06)(Marichal, B.)(fr)(Disk 1 of 2).zip | 2011-12-05 12:42 | 300K | |
![[ ]](/icons/compressed.gif) | COMA v2.50 (1994-10-20)(Softbaer GbR)(de-en)(SW).zip | 2011-12-05 12:42 | 302K | |
![[ ]](/icons/compressed.gif) | Font Disk 2 (1992-10-03)(Germs).zip | 2011-12-05 12:43 | 302K | |
![[ ]](/icons/compressed.gif) | Lattice C ST v5.60 (1993-11-08)(HiSoft)(Disk 2 of 7).zip | 2011-12-05 12:43 | 302K | |
![[ ]](/icons/compressed.gif) | HiSoft Basic v2.10 (1992)(HiSoft)(Disk 1 of 3)[cr Elite].zip | 2011-12-05 12:43 | 303K | |
![[ ]](/icons/compressed.gif) | Artis 4 - Prism Paint 2 (19xx)(Lexicor)[cr Fuzion - Cyrix].zip | 2011-12-05 12:42 | 303K | |
![[ ]](/icons/compressed.gif) | Devpac v3.0 (1992)(HiSoft)[compressed archive].zip | 2011-12-05 12:42 | 304K | |
![[ ]](/icons/compressed.gif) | Devpac Assembler v3 (19xx)(Atari ST Application Center).zip | 2011-12-05 12:42 | 304K | |
![[ ]](/icons/compressed.gif) | Neodesk v3.01 (1990)(Gribnif)[Registered].zip | 2011-12-05 12:43 | 304K | |
![[ ]](/icons/compressed.gif) | HiSoft Basic v2.10 (1992)(HiSoft)(Disk 1 of 3).zip | 2011-12-05 12:43 | 304K | |
![[ ]](/icons/compressed.gif) | Happy Music v1.0 (19xx)(Steinberg)[monochrome].zip | 2011-12-05 12:43 | 304K | |
![[ ]](/icons/compressed.gif) | Megatizer v2.4 (1992-04-13)(Sector One)[a].zip | 2011-12-05 12:43 | 304K | |
![[ ]](/icons/compressed.gif) | Jazz Guitarist v1.0 (1993)(PG Music)(Disk 2 of 3).zip | 2011-12-05 12:43 | 306K | |
![[ ]](/icons/compressed.gif) | Easy-Draw v2.01 (1986)(Migraph)[m Zorro II].zip | 2011-12-05 12:42 | 306K | |
![[ ]](/icons/compressed.gif) | GFA Song-Editor (1992-09-13)(IDL Software GmbH)(de)(PD).zip | 2011-12-05 12:43 | 306K | |
![[ ]](/icons/compressed.gif) | MiNT v1.12 (1994-11-15)(Atari Corp.).zip | 2011-12-05 12:43 | 306K | |
![[ ]](/icons/compressed.gif) | Positive Image 68040 v1.12 (demo) (19xx)(Stephan Found)[a][Falcon only].zip | 2011-12-05 12:43 | 308K | |
![[ ]](/icons/compressed.gif) | Didot Professional v3.129 (1991)(3K Computerbild)(de)(Disk 1 of 3)[copy to harddisk].zip | 2011-12-05 12:42 | 308K | |
![[ ]](/icons/compressed.gif) | Fred's Find Game & Editor (1993)(RIGamortis).zip | 2011-12-05 12:43 | 309K | |
![[ ]](/icons/compressed.gif) | Power Scan Professional v1.03 (19xx)(Power Computing).zip | 2011-12-05 12:43 | 309K | |
![[ ]](/icons/compressed.gif) | Positive Image 68040 v1.12 (demo) (19xx)(Stephan Found)[Falcon only].zip | 2011-12-05 12:43 | 309K | |
![[ ]](/icons/compressed.gif) | Notator v3.0 (1991)(Adam - Lengeling)[cr MCA][a].zip | 2011-12-05 12:43 | 309K | |
![[ ]](/icons/compressed.gif) | Digital Song Teaser MOD Player (19xx)(Overlanders).zip | 2011-12-05 12:42 | 310K | |
![[ ]](/icons/compressed.gif) | FastCopy Pro v1.2 (1994)(ICD).zip | 2011-12-05 12:42 | 310K | |
![[ ]](/icons/compressed.gif) | Notator v3.0 (1991)(Adam - Lengeling)[cr MCA][a2].zip | 2011-12-05 12:43 | 310K | |
![[ ]](/icons/compressed.gif) | Disector ST (1988)(Softcell).zip | 2011-12-05 12:42 | 310K | |
![[ ]](/icons/compressed.gif) | Didot Professional v3.129 (1991)(3K Computerbild)(de)(Disk 2 of 3)[copy to harddisk].zip | 2011-12-05 12:42 | 311K | |
![[ ]](/icons/compressed.gif) | DA's Vektor v1.2 (1993-01-24)(Digital Arts)(de)(Disk 4 of 7).zip | 2011-12-05 12:42 | 312K | |
![[ ]](/icons/compressed.gif) | Positive Image 68030 v1.12 (demo) (19xx)(Stephan Found)[a][Falcon only].zip | 2011-12-05 12:43 | 312K | |
![[ ]](/icons/compressed.gif) | Papillon (19xx)(-)[b].zip | 2011-12-05 12:43 | 313K | |
![[ ]](/icons/compressed.gif) | Demo Construction Kit (1992)(Eurosoft)(fr)(Disk 1 of 3)[a2].zip | 2011-12-05 12:42 | 313K | |
![[ ]](/icons/compressed.gif) | GEM View v2.13 (1992-12-02)(Fiebelkorn, Dieter)(SW)(Disk 1 of 2).zip | 2011-12-05 12:43 | 313K | |
![[ ]](/icons/compressed.gif) | MiNT v7.9 (1992-0-08)(Atari Corp.)(Disk 1 of 3).zip | 2011-12-05 12:43 | 313K | |
![[ ]](/icons/compressed.gif) | Positive Image 68030 v1.12 (demo) (19xx)(Stephan Found)[Falcon only].zip | 2011-12-05 12:43 | 313K | |
![[ ]](/icons/compressed.gif) | Photochrome v2.01 (1992)(Pixel Twins)(SW).zip | 2011-12-05 12:43 | 313K | |
![[ ]](/icons/compressed.gif) | Atari Works v1.207 (1993-07-22)(STP Electronics Ltd.)(Disk 2 of 3).zip | 2011-12-05 12:42 | 314K | |
![[ ]](/icons/compressed.gif) | Harlekin III (1993-03-12)(HiSoft).zip | 2011-12-05 12:43 | 316K | |
![[ ]](/icons/compressed.gif) | MultiTOS (1993)(Atari Corp.)(fr).zip | 2011-12-05 12:43 | 317K | |
![[ ]](/icons/compressed.gif) | Gemini vx.x (1989)(Eissing, Stefan - Gereon Steffens)(SW)[b].zip | 2011-12-05 12:43 | 317K | |
![[ ]](/icons/compressed.gif) | Librairies Dynamiques GEM v2.30 (2002-05)(Landemarre, Olivier)(en-fr)(FW)[b].zip | 2011-12-05 12:43 | 317K | |
![[ ]](/icons/compressed.gif) | Full Screen Construction Kit (19xx)(FMC).zip | 2011-12-05 12:43 | 317K | |
![[ ]](/icons/compressed.gif) | Full Screen Construction Kit (19xx)(FMC)[a].zip | 2011-12-05 12:43 | 317K | |
![[ ]](/icons/compressed.gif) | Harddiskdriver v5.3.0 (1991)(ICD)(de).zip | 2011-12-05 12:43 | 318K | |
![[ ]](/icons/compressed.gif) | Invision Elite v2.0 (1993-02-01)(DMC).zip | 2011-12-05 12:43 | 318K | |
![[ ]](/icons/compressed.gif) | Paintshop v2.03 (1992)(Software & Computer Elektronik Team)(SW).zip | 2011-12-05 12:43 | 319K | |
![[ ]](/icons/compressed.gif) | MiNT v7.9 (1992-0-08)(Atari Corp.)(Disk 2 of 3).zip | 2011-12-05 12:43 | 320K | |
![[ ]](/icons/compressed.gif) | Music Studio Disk 2 (19xx)(Dilithium).zip | 2011-12-05 12:43 | 320K | |
![[ ]](/icons/compressed.gif) | Lattice C v 5.0602 (1990)(HiSoft).zip | 2011-12-05 12:43 | 321K | |
![[ ]](/icons/compressed.gif) | MegaPaint (19xx)(TommySoftware)[b].zip | 2011-12-05 12:43 | 322K | |
![[ ]](/icons/compressed.gif) | Didot Professional v4.141 (1991)(3K Computerbild)(M3)(Disk 1 of 3)[cr Elite][copy to harddisk].zip | 2011-12-05 12:42 | 322K | |
![[ ]](/icons/compressed.gif) | MusicMon v2.0 (1993)(Galactic).zip | 2011-12-05 12:43 | 322K | |
![[ ]](/icons/compressed.gif) | Interactive Manual Maker - Extended Version (1991)(P.B. Bloemendaal).zip | 2011-12-05 12:43 | 322K | |
![[ ]](/icons/compressed.gif) | MicroEMACS v3.12 (1993-04-22)(Lawrence, Daniel M.).zip | 2011-12-05 12:43 | 325K | |
![[ ]](/icons/compressed.gif) | Protracker ST v1.2 (19xx)(Oygard, Karl Anders - Runde, Hans Arild)[m Noid].zip | 2011-12-05 12:43 | 326K | |
![[ ]](/icons/compressed.gif) | Lavadraw III (1988-08)(K&L Datentechnik)(de).zip | 2011-12-05 12:43 | 326K | |
![[ ]](/icons/compressed.gif) | Hyper Paint v2.0 (1990)(Atari Corp.).zip | 2011-12-05 12:43 | 327K | |
![[ ]](/icons/compressed.gif) | Da Capo v1.22 (1995-07-15)(Dr. Francisco Mendez)(de)(SW).zip | 2011-12-05 12:42 | 327K | |
![[ ]](/icons/compressed.gif) | Calligrapher (1991)(Working Title).zip | 2011-12-05 12:42 | 328K | |
![[ ]](/icons/compressed.gif) | Lasergraph Pro v2.40 (1991)(Bonnifet, S. - Guimberteau, P.)(Disk 2 of 6)(Disk Fontagraph)[cr ICS].zip | 2011-12-05 12:43 | 329K | |
![[ ]](/icons/compressed.gif) | GFA Basic v2.02 (1987-09-15)(GFA Systemtechnik).zip | 2011-12-05 12:43 | 330K | |
![[ ]](/icons/compressed.gif) | Dali v4 (1990)(ALM)(Disk 2 of 2)[m Zorro II].zip | 2011-12-05 12:42 | 334K | |
![[ ]](/icons/compressed.gif) | DA's Vektor v1.2 (1993-01-24)(Digital Arts)(de)(Disk 6 of 7).zip | 2011-12-05 12:42 | 335K | |
![[ ]](/icons/compressed.gif) | OMEn v2.46d (demo) (19xx)(Esquimalt Digital Logic Inc.)[Demo Time expired].zip | 2011-12-05 12:43 | 337K | |
![[ ]](/icons/compressed.gif) | ICD Pro Festplattentreiber v5.50 (1991)(ICD Inc.)(de).zip | 2011-12-05 12:43 | 338K | |
![[ ]](/icons/compressed.gif) | Chronos 3D Key Frame Animator v1.0 (1991-04-15)(Dana, Paul)(Disk 4 of 4)[b].zip | 2011-12-05 12:42 | 339K | |
![[ ]](/icons/compressed.gif) | Keyboard Controlled Sequencer v4.0 (1990-10-15)(Dr. T's Music Software)[a].zip | 2011-12-05 12:43 | 339K | |
![[ ]](/icons/compressed.gif) | Copiers 2 (19xx)(Misc).zip | 2011-12-05 12:42 | 340K | |
![[ ]](/icons/compressed.gif) | DA's Vektor v1.2 (1993-01-24)(Digital Arts)(de)(Disk 3 of 7).zip | 2011-12-05 12:42 | 341K | |
![[ ]](/icons/compressed.gif) | KAOSDesk v2.0 (1989)(Kromke, Andreas)(de).zip | 2011-12-05 12:43 | 342K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v3.01 (1992)(Steinberg)(Disk 1 of 3)[a].zip | 2011-12-05 12:42 | 345K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v3.01 (19xx)(Steinberg)(Disk 1 of 3).zip | 2011-12-05 12:42 | 345K | |
![[ ]](/icons/compressed.gif) | Papyrus v1.01 (1992-05-24)(Digital Desktop Software)(de)[cr Elite].zip | 2011-12-05 12:43 | 346K | |
![[ ]](/icons/compressed.gif) | Overlay v0.10.3 (demo-playable) (1993)(OverScan)(Disk 3 of 3).zip | 2011-12-05 12:43 | 347K | |
![[ ]](/icons/compressed.gif) | Da Capo v1.23 (1996-06-17)(Dr. Francisco Mendez)(de)[cr Vectronix].zip | 2011-12-05 12:42 | 348K | |
![[ ]](/icons/compressed.gif) | Chronos 3D Key Frame Animator v1.0 (1991-04-15)(Dana, Paul)(Disk 3 of 4)[b].zip | 2011-12-05 12:42 | 349K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 1 of 2)[cr MCA][a3].zip | 2011-12-05 12:42 | 351K | |
![[ ]](/icons/compressed.gif) | Diskus v3.32 (1995)(Creative Computer Design)[cr Superior].zip | 2011-12-05 12:42 | 351K | |
![[ ]](/icons/compressed.gif) | Diskus v3.32 (1995)(Creative Computer Design)[cr Superior][a].zip | 2011-12-05 12:42 | 351K | |
![[ ]](/icons/compressed.gif) | Leo ST v1.0F (1991)(Micro Application & Data Becker)(fr)(Disk 1 of 2).zip | 2011-12-05 12:43 | 351K | |
![[ ]](/icons/compressed.gif) | Invision Elite v1.13 (1992-08-12)(DMC)[cr ICS][a].zip | 2011-12-05 12:43 | 352K | |
![[ ]](/icons/compressed.gif) | Dali v4 (1990)(ALM)(Disk 1 of 2)[m Zorro II].zip | 2011-12-05 12:42 | 352K | |
![[ ]](/icons/compressed.gif) | N.AES v1.10d (1996-04-30)(-)(Disk 3 of 3)[cr Vectronix][Disk 1 and 2 missing].zip | 2011-12-05 12:43 | 353K | |
![[ ]](/icons/compressed.gif) | Freedom v1.15d (19xx)(-)[b].zip | 2011-12-05 12:43 | 354K | |
![[ ]](/icons/compressed.gif) | Freedrum v2.0 (19xx)(RL).zip | 2011-12-05 12:43 | 354K | |
![[ ]](/icons/compressed.gif) | MS-Dos v4.01 (19xx)(Microsoft).zip | 2011-12-05 12:43 | 355K | |
![[ ]](/icons/compressed.gif) | MiNT v0.95 (1992-05-08)(Atari Corp.)(Disk 1 of 2).zip | 2011-12-05 12:43 | 356K | |
![[ ]](/icons/compressed.gif) | Freedom v1.14a (19xx)(-)[b].zip | 2011-12-05 12:43 | 356K | |
![[ ]](/icons/compressed.gif) | Killer v 2.0, The (1990)(Omikron)(fr).zip | 2011-12-05 12:43 | 358K | |
![[ ]](/icons/compressed.gif) | Intro Concept (1990)(Conceptors)(en-fr)(FW).zip | 2011-12-05 12:43 | 358K | |
![[ ]](/icons/compressed.gif) | 2 in 1 v1.51 (1995-12-12)(Duchalski, Gregor)(fr).zip | 2011-12-05 12:42 | 358K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.5 (19xx)(GFA Systemtechnik)[a].zip | 2011-12-05 12:43 | 360K | |
![[ ]](/icons/compressed.gif) | Harddisk Treiber v8.13 (2003)(Seimet, Uwe)(de)[a2].zip | 2011-12-05 12:43 | 361K | |
![[ ]](/icons/compressed.gif) | Harddisk Treiber v8.13 (2003)(Seimet, Uwe)(de).zip | 2011-12-05 12:43 | 361K | |
![[ ]](/icons/compressed.gif) | Harddisk Treiber v8.13 (2003)(Seimet, Uwe)(de)[a].zip | 2011-12-05 12:43 | 361K | |
![[ ]](/icons/compressed.gif) | Delirious Source Disk (19xx)(-).zip | 2011-12-05 12:42 | 362K | |
![[ ]](/icons/compressed.gif) | MS-DOS v5 Startdisk (19xx)(-).zip | 2011-12-05 12:43 | 363K | |
![[ ]](/icons/compressed.gif) | Protracker (1992-02)(Equinox).zip | 2011-12-05 12:43 | 363K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 1 of 2)[cr MCA][a2].zip | 2011-12-05 12:42 | 364K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 1 of 2)[cr MCA][a].zip | 2011-12-05 12:42 | 364K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 1 of 2).zip | 2011-12-05 12:42 | 364K | |
![[ ]](/icons/compressed.gif) | COMA v2.80 (1995-04-14)(Softbaer GbR)(de-en)(SW).zip | 2011-12-05 12:42 | 364K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 1 of 2)[cr MCA].zip | 2011-12-05 12:42 | 364K | |
![[ ]](/icons/compressed.gif) | Otto's Ressource Construction Set v1.00 (1991-10-10)(Th. Otto)(fr).zip | 2011-12-05 12:43 | 364K | |
![[ ]](/icons/compressed.gif) | Page Stream v2.1 (1991)(Soft-Logik Publishing)(Disk 1 of 4).zip | 2011-12-05 12:43 | 365K | |
![[ ]](/icons/compressed.gif) | Geneva (1991)(Gribnif).zip | 2011-12-05 12:43 | 366K | |
![[ ]](/icons/compressed.gif) | Notator v3.0 (1991)(Adam - Lengeling)[cr MCA].zip | 2011-12-05 12:43 | 366K | |
![[ ]](/icons/compressed.gif) | Librairie Demos (19xx)(-)(fr).zip | 2011-12-05 12:43 | 366K | |
![[ ]](/icons/compressed.gif) | Geneva Neodesk (1993)(Gribnif).zip | 2011-12-05 12:43 | 366K | |
![[ ]](/icons/compressed.gif) | COMA v2.70 (1995-02-23)(Softbaer GbR)(de-en)(SW).zip | 2011-12-05 12:42 | 366K | |
![[ ]](/icons/compressed.gif) | Aladin Disk (19xx)(-).zip | 2011-12-05 12:42 | 367K | |
![[ ]](/icons/compressed.gif) | Charly Image v2.00 (1992)(Mikroelektronik, Wilhelm)(de)(Disk 1 of 2).zip | 2011-12-05 12:42 | 371K | |
![[ ]](/icons/compressed.gif) | LDW Power v2.00 (1990)(Logical Design Works).zip | 2011-12-05 12:43 | 371K | |
![[ ]](/icons/compressed.gif) | GFA Basic v3.02 (19xx)(GFA Systemtechnik).zip | 2011-12-05 12:43 | 372K | |
![[ ]](/icons/compressed.gif) | Geneva 4 (1991)(Gribnif)(Disk 1 of 2).zip | 2011-12-05 12:43 | 372K | |
![[ ]](/icons/compressed.gif) | Papyrus v1.0 (1992-05-07)(Digital Desktop Software)(fr).zip | 2011-12-05 12:43 | 372K | |
![[ ]](/icons/compressed.gif) | LDW Power v2.00 (1990)(Logical Design Works)[a].zip | 2011-12-05 12:43 | 374K | |
![[ ]](/icons/compressed.gif) | Geneva 3 (1991)(Gribnif).zip | 2011-12-05 12:43 | 375K | |
![[ ]](/icons/compressed.gif) | Geneva v1.03 (1993-12-31)(Gribnif).zip | 2011-12-05 12:43 | 375K | |
![[ ]](/icons/compressed.gif) | Platon v2.1 (1991-02-19)(VHF)(de)(Disk 1 of 3)[cr].zip | 2011-12-05 12:43 | 377K | |
![[ ]](/icons/compressed.gif) | BD Studio (1991)(ESAT).zip | 2011-12-05 12:42 | 377K | |
![[ ]](/icons/compressed.gif) | Bubbles v1.2 (1998)(Gruszka, Uli)(de)(FW).zip | 2011-12-05 12:42 | 377K | |
![[ ]](/icons/compressed.gif) | Invision Elite v1.13 (1992-08-12)(DMC)[cr ICS].zip | 2011-12-05 12:43 | 378K | |
![[ ]](/icons/compressed.gif) | COMA v3.10 (1995-12-01)(Softbaer GbR)(de-en)(SW).zip | 2011-12-05 12:42 | 379K | |
![[ ]](/icons/compressed.gif) | Page Stream v2.1 (1991)(Soft-Logik Publishing)(Disk 3 of 4).zip | 2011-12-05 12:43 | 380K | |
![[ ]](/icons/compressed.gif) | Harddisk Treiber v7.51 (1998)(Seimet, Uwe).zip | 2011-12-05 12:43 | 380K | |
![[ ]](/icons/compressed.gif) | Devpac v3.0 (1992)(HiSoft).zip | 2011-12-05 12:42 | 381K | |
![[ ]](/icons/compressed.gif) | COMA v5.3.2 (2003-02-05)(Softbaer GbR)(SW).zip | 2011-12-05 12:42 | 382K | |
![[ ]](/icons/compressed.gif) | CompoScript v1.0 (1991)(Compo Software - Lincoln)(Disk 4 of 4).zip | 2011-12-05 12:42 | 382K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)(Disk 1 of 2)[cr MCA][a4].zip | 2011-12-05 12:42 | 386K | |
![[ ]](/icons/compressed.gif) | DA's Vektor Pro v2.0 (1993-09-28)(Digital Arts)(Disk 2 of 2).zip | 2011-12-05 12:42 | 387K | |
![[ ]](/icons/compressed.gif) | Audio Sculpture (demo) (1990)(Synchron Assembly).zip | 2011-12-05 12:42 | 387K | |
![[ ]](/icons/compressed.gif) | Didot Professional v3.129 (1991)(3K Computerbild)(de)(Disk 3 of 3)[copy to harddisk].zip | 2011-12-05 12:42 | 388K | |
![[ ]](/icons/compressed.gif) | Harddisk Treiber v4.0 (1995)(Seimet, Uwe).zip | 2011-12-05 12:43 | 390K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v2.0 (1989)(Steinberg)[cr MCA].zip | 2011-12-05 12:42 | 391K | |
![[ ]](/icons/compressed.gif) | Intro Concept (1990)(Conceptors)(fr)(FW).zip | 2011-12-05 12:43 | 391K | |
![[ ]](/icons/compressed.gif) | Devpac v3.10 (1992)(HiSoft).zip | 2011-12-05 12:42 | 392K | |
![[ ]](/icons/compressed.gif) | GEM View v2.13 (1992-12-02)(Fiebelkorn, Dieter)(SW)(Disk 2 of 2).zip | 2011-12-05 12:43 | 393K | |
![[ ]](/icons/compressed.gif) | Devpac v3.10 (1992)(HiSoft)[a].zip | 2011-12-05 12:42 | 393K | |
![[ ]](/icons/compressed.gif) | Demo Construction Kit (1992)(Eurosoft)(fr)(Disk 1 of 3)[a].zip | 2011-12-05 12:42 | 394K | |
![[ ]](/icons/compressed.gif) | Certificate Maker v1.0 (1987-04-22)(Springboard)(Disk 1 of 2)[cr BOSS].zip | 2011-12-05 12:42 | 396K | |
![[ ]](/icons/compressed.gif) | Encore v1.35 (1990)(Passport Designs)(Disk 3 of 3).zip | 2011-12-05 12:42 | 396K | |
![[ ]](/icons/compressed.gif) | Loader Construction Kit v1.93F (1993-07-05)(Pixel Boys)(fr)[cr Squale][m Mr Nours].zip | 2011-12-05 12:43 | 397K | |
![[ ]](/icons/compressed.gif) | Prism Paint v1.0 (1991)(Lexicor Software)(Disk 3 of 3).zip | 2011-12-05 12:43 | 397K | |
![[ ]](/icons/compressed.gif) | Keyboard Controlled Sequencer v4.0 (1990-10-15)(Dr. T's Music Software).zip | 2011-12-05 12:43 | 397K | |
![[ ]](/icons/compressed.gif) | Lattice C ST v5.60 (1993-11-08)(HiSoft)(Disk 1 of 7).zip | 2011-12-05 12:43 | 401K | |
![[ ]](/icons/compressed.gif) | CS-TeX v4.0 (1992)(Strunk, Christoph)(de-en)(Disk 6 of 8).zip | 2011-12-05 12:42 | 402K | |
![[ ]](/icons/compressed.gif) | Prism Paint v1.0 (1991)(Lexicor Software)(Disk 2 of 3).zip | 2011-12-05 12:43 | 404K | |
![[ ]](/icons/compressed.gif) | CD-Recorder v2.36 (1998)(Sound Pool).zip | 2011-12-05 12:42 | 405K | |
![[ ]](/icons/compressed.gif) | COMA v5.3.2 (2003-02-05)(Softbaer GbR)(de)(SW).zip | 2011-12-05 12:42 | 406K | |
![[ ]](/icons/compressed.gif) | Papyrus v2.09 (1993-05-28)(Papyrus)[cr Elite].zip | 2011-12-05 12:43 | 409K | |
![[ ]](/icons/compressed.gif) | Logo (1985)(Atari Corp.)(Fi).zip | 2011-12-05 12:43 | 409K | |
![[ ]](/icons/compressed.gif) | Disco Scopie ST v3.00 (1990)(Esat Software)(fr).zip | 2011-12-05 12:42 | 411K | |
![[ ]](/icons/compressed.gif) | Bildbank v1.91 (1989)(Wissenschaft&Medizin Laass)(de)(PD).zip | 2011-12-05 12:42 | 412K | |
![[ ]](/icons/compressed.gif) | Atari Works (19xx)(STP Electronics Ltd.)(fr)[b].zip | 2011-12-05 12:42 | 416K | |
![[ ]](/icons/compressed.gif) | DIGI-SOUND Construction Kit v3.02 (1989)(Czaputa, Claus)(de)(PD).zip | 2011-12-05 12:42 | 417K | |
![[ ]](/icons/compressed.gif) | Certificate Maker v1.0 (1987-04-22)(Springboard)(Disk 2 of 2)[cr BOSS].zip | 2011-12-05 12:42 | 421K | |
![[ ]](/icons/compressed.gif) | Page Stream v2.1 (1991)(Soft-Logik Publishing)(Disk 4 of 4).zip | 2011-12-05 12:43 | 422K | |
![[ ]](/icons/compressed.gif) | Demo Construction Kit (1992)(Eurosoft)(fr)(Disk 3 of 3)[a].zip | 2011-12-05 12:42 | 427K | |
![[ ]](/icons/compressed.gif) | Pad v2.4 (1991-02-16)(Gemmel, Heiko)(SW).zip | 2011-12-05 12:43 | 427K | |
![[ ]](/icons/compressed.gif) | artiST v1.0 (1993-11-03)(Laubenberger, Stefan)(SW).zip | 2011-12-05 12:43 | 430K | |
![[ ]](/icons/compressed.gif) | Game Cracker Version III (19xx)(Medway Boys).zip | 2011-12-05 12:43 | 431K | |
![[ ]](/icons/compressed.gif) | Funface v1.1e (1989)(Compo)(de).zip | 2011-12-05 12:43 | 433K | |
![[ ]](/icons/compressed.gif) | Demo Construction Kit (1992)(Eurosoft)(fr)(Disk 3 of 3).zip | 2011-12-05 12:42 | 433K | |
![[ ]](/icons/compressed.gif) | Funface v1.1f (1989-07-25)(-)(fr).zip | 2011-12-05 12:43 | 434K | |
![[ ]](/icons/compressed.gif) | FontGDOS (1992-05-28)(Atari Corp.).zip | 2011-12-05 12:43 | 435K | |
![[ ]](/icons/compressed.gif) | FontGDOS (1992-05-28)(Atari Corp.)[a].zip | 2011-12-05 12:43 | 435K | |
![[ ]](/icons/compressed.gif) | COMA v4.0.1 (1997-05-16)(Softbaer GbR)(de-en)(SW).zip | 2011-12-05 12:42 | 436K | |
![[ ]](/icons/compressed.gif) | Funface v1.1f (1989-07-25)(-)(fr)[a].zip | 2011-12-05 12:42 | 438K | |
![[ ]](/icons/compressed.gif) | Funface v1.1f (1989-07-25)(-)(fr)[a2].zip | 2011-12-05 12:42 | 438K | |
![[ ]](/icons/compressed.gif) | Imagecopy v4.01d (demo-playable) (1995-10-03)(FaST Club).zip | 2011-12-05 12:43 | 439K | |
![[ ]](/icons/compressed.gif) | Demo Construction Kit (1991)(Eurosoft)(fr)(Disk 1 of 3)[cr Elite][m Megatari].zip | 2011-12-05 12:42 | 439K | |
![[ ]](/icons/compressed.gif) | Maxifile (1991)(Codehead Software).zip | 2011-12-05 12:43 | 444K | |
![[ ]](/icons/compressed.gif) | CS-TeX v4.0 (1992)(Strunk, Christoph)(de-en)(Disk 5 of 8).zip | 2011-12-05 12:42 | 448K | |
![[ ]](/icons/compressed.gif) | Crack Art (demo) (1992)(Borchers, Jan - Ruttger, Detlef).zip | 2011-12-05 12:42 | 451K | |
![[ ]](/icons/compressed.gif) | Demo Construction Kit (1992)(Eurosoft)(fr)(Disk 1 of 3).zip | 2011-12-05 12:42 | 452K | |
![[ ]](/icons/compressed.gif) | Noise Tracker v1.5 (19xx)(Empire)[a].zip | 2011-12-05 12:43 | 453K | |
![[ ]](/icons/compressed.gif) | Demo Construction Kit (1991)(Eurosoft)(fr)(Disk 3 of 3)[cr Elite][m Megatari].zip | 2011-12-05 12:42 | 455K | |
![[ ]](/icons/compressed.gif) | CD-Player STE (1990)(Light).zip | 2011-12-05 12:42 | 458K | |
![[ ]](/icons/compressed.gif) | Didot Professional v4.141 (1991)(3K Computerbild)(M3)(Disk 2 of 3)[cr Elite][copy to harddisk].zip | 2011-12-05 12:42 | 464K | |
![[ ]](/icons/compressed.gif) | Hdp Stack (1995-03)(Heyer - Neumann).zip | 2011-12-05 12:43 | 465K | |
![[ ]](/icons/compressed.gif) | Midnight v1.14 (1993-04)(Application Systems Paris)(fr).zip | 2011-12-05 12:43 | 465K | |
![[ ]](/icons/compressed.gif) | IMG Mixer v1.10 (1994-05-06)(Wallmann, Matthias)(de)(FW).zip | 2011-12-05 12:43 | 467K | |
![[ ]](/icons/compressed.gif) | Neodesk 4 Release 001 (1994-08-18)(Gribnif)[Unregistered].zip | 2011-12-05 12:43 | 470K | |
![[ ]](/icons/compressed.gif) | COMA v4.50 (1998-04-25)(Softbaer GbR)(de-en)(SW).zip | 2011-12-05 12:42 | 470K | |
![[ ]](/icons/compressed.gif) | Image Copy v3.52d (demo-playable) (1994-11-20)(FaST Club).zip | 2011-12-05 12:43 | 470K | |
![[ ]](/icons/compressed.gif) | Deluxe Paint v1.0 (1990)(Electronic Arts)[a2].zip | 2011-12-05 12:42 | 474K | |
![[ ]](/icons/compressed.gif) | Deluxe Paint v1.0 (1990)(Electronic Arts)[a].zip | 2011-12-05 12:42 | 474K | |
![[ ]](/icons/compressed.gif) | Neodesk 4 Release 002 (1994-09-26)(Gribnif)[Registered].zip | 2011-12-05 12:43 | 474K | |
![[ ]](/icons/compressed.gif) | Neodesk 4 Release 002 (1994-09-26)(Gribnif)[a][Registered].zip | 2011-12-05 12:43 | 475K | |
![[ ]](/icons/compressed.gif) | Octalyser, The (19xx)(Alan F. Blade)(SW).zip | 2011-12-05 12:43 | 476K | |
![[ ]](/icons/compressed.gif) | ICD Pro Festplattentreiber v6.55 (1994)(ICD Inc.)(de)[a].zip | 2011-12-05 12:43 | 479K | |
![[ ]](/icons/compressed.gif) | Midnight v1.12 (1993-03)(Adam, Mario - Hartwig zur Nieden)[a].zip | 2011-12-05 12:43 | 480K | |
![[ ]](/icons/compressed.gif) | Midi Quest v1.01 (1990)(Sound Quest)(Disk 2 of 2).zip | 2011-12-05 12:43 | 480K | |
![[ ]](/icons/compressed.gif) | Midnight v1.12 (1993-03)(Adam, Mario - Hartwig zur Nieden).zip | 2011-12-05 12:43 | 481K | |
![[ ]](/icons/compressed.gif) | Becker Design v1.00d (1991)(Data Becker)(de)(Disk 1 of 2).zip | 2011-12-05 12:42 | 482K | |
![[ ]](/icons/compressed.gif) | Atari Works v1.207 (1993-07-22)(STP Electronics Ltd.)(Disk 3 of 3).zip | 2011-12-05 12:42 | 487K | |
![[ ]](/icons/compressed.gif) | Digit Tracker (1992)(Galactic)(Disk 2 of 3).zip | 2011-12-05 12:42 | 492K | |
![[ ]](/icons/compressed.gif) | Dachemore 3 (1993-10-01)(-).zip | 2011-12-05 12:42 | 493K | |
![[ ]](/icons/compressed.gif) | 1st Word Plus v4 (199x)(GST)(Disk 2 of 3)[HD].zip | 2011-12-05 12:42 | 494K | |
![[ ]](/icons/compressed.gif) | Imagecopy v4.0 (1995-06-26)(Fast Club)(Disk 1 of 2).zip | 2011-12-05 12:43 | 497K | |
![[ ]](/icons/compressed.gif) | ICD Pro Festplattentreiber v6.55 (1994)(ICD Inc.)(de).zip | 2011-12-05 12:43 | 498K | |
![[ ]](/icons/compressed.gif) | Noise Tracker v1.5 (19xx)(Empire).zip | 2011-12-05 12:43 | 504K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v3.0 (1989)(Steinberg)(Disk 1 of 3)[cr MCA].zip | 2011-12-05 12:42 | 506K | |
![[ ]](/icons/compressed.gif) | Digit Tracker (1992)(Galactic)(Disk 3 of 3).zip | 2011-12-05 12:42 | 507K | |
![[ ]](/icons/compressed.gif) | Neodesk 4 Release 005 (1996-03-17)(Gribnif)[Registered].zip | 2011-12-05 12:43 | 509K | |
![[ ]](/icons/compressed.gif) | Mouse Boot 4 (1992)(SRL Systems).zip | 2011-12-05 12:43 | 511K | |
![[ ]](/icons/compressed.gif) | Cubase - Desktop Midi Recording System v3.0 (1989)(Steinberg)[cr SCC].zip | 2011-12-05 12:42 | 511K | |
![[ ]](/icons/compressed.gif) | Gemini v1.999e (1994-12-21)(Eissing, Stefan)(de)(SW)[a].zip | 2011-12-05 12:43 | 515K | |
![[ ]](/icons/compressed.gif) | Demo Construction Kit (demo) (1991)(Eurosoft)(en-fr)[cr Elite].zip | 2011-12-05 12:42 | 516K | |
![[ ]](/icons/compressed.gif) | Gemini v1.999e (1994-12-21)(Eissing, Stefan)(de)(SW).zip | 2011-12-05 12:43 | 518K | |
![[ ]](/icons/compressed.gif) | Gortet v2.0 (19xx)(Cowtan, Kevin - Powty, Rob)[cr Genesis].zip | 2011-12-05 12:43 | 519K | |
![[ ]](/icons/compressed.gif) | CompoScript v1.0 (1991)(Compo Software - Lincoln)(Disk 2 of 4).zip | 2011-12-05 12:42 | 520K | |
![[ ]](/icons/compressed.gif) | CompoScript v1.0 (1991)(Compo Software - Lincoln)(Disk 3 of 4).zip | 2011-12-05 12:42 | 521K | |
![[ ]](/icons/compressed.gif) | Crazy Sounds v1.23 (1992)(Maxon)(de)(Disk 2 of 2).zip | 2011-12-05 12:42 | 521K | |
![[ ]](/icons/compressed.gif) | Kuma Spreadsheet v4.07 (1990)(Kuma Computers Limited)(fr)(Disk 1 of 3).zip | 2011-12-05 12:43 | 527K | |
![[ ]](/icons/compressed.gif) | 1st Word Plus v4 (199x)(GST)(Disk 3 of 3)[HD].zip | 2011-12-05 12:42 | 529K | |
![[ ]](/icons/compressed.gif) | Gdos (19xx)(-)(Disk 5 of 6).zip | 2011-12-05 12:43 | 541K | |
![[ ]](/icons/compressed.gif) | CS-TeX v4.0 (1992)(Strunk, Christoph)(de-en)(Disk 4 of 8).zip | 2011-12-05 12:42 | 545K | |
![[ ]](/icons/compressed.gif) | Gemar v3.06 (1996-11-29)(Engel, Steffen)(de)(SW).zip | 2011-12-05 12:43 | 545K | |
![[ ]](/icons/compressed.gif) | Atari HD Utility Disk v2.0 (1988)(Atari Corp).zip | 2011-12-05 12:42 | 546K | |
![[ ]](/icons/compressed.gif) | CS-TeX v4.0 (1992)(Strunk, Christoph)(de-en)(Disk 2 of 8).zip | 2011-12-05 12:42 | 564K | |
![[ ]](/icons/compressed.gif) | 1st Word Plus v4 (199x)(GST)(Disk 1 of 3)[HD].zip | 2011-12-05 12:42 | 564K | |
![[ ]](/icons/compressed.gif) | Milan Support Disk 1 (1999)(Milan-Computer-Systems)(de).zip | 2011-12-05 12:43 | 570K | |
![[ ]](/icons/compressed.gif) | Positive Image v1.11 (1996)(Floppy Shop)[cr Vectronix].zip | 2011-12-05 12:43 | 574K | |
![[ ]](/icons/compressed.gif) | Kleurboek v1.0 (1989-09)(Strike-a-Lite)(nl).zip | 2011-12-05 12:43 | 578K | |
![[ ]](/icons/compressed.gif) | Atari Jaguar Information Disk (19xx)(-).zip | 2011-12-05 12:42 | 578K | |
![[ ]](/icons/compressed.gif) | KidTalk v1.0 (19xx)(First Byte).zip | 2011-12-05 12:43 | 580K | |
![[ ]](/icons/compressed.gif) | CS-TeX v4.0 (1992)(Strunk, Christoph)(de-en)(Disk 8 of 8).zip | 2011-12-05 12:42 | 603K | |
![[ ]](/icons/compressed.gif) | Muzaxx Rippozor v1.00 - Data Disk 1 v 0.90 (1991)(Artis Magia)(fr).zip | 2011-12-05 12:43 | 610K | |
![[ ]](/icons/compressed.gif) | CS-TeX v4.0 (1992)(Strunk, Christoph)(de-en)(Disk 1 of 8).zip | 2011-12-05 12:42 | 612K | |
![[ ]](/icons/compressed.gif) | Mix Machine +, The (19xx)(Dynamite Software)(Disk 1 of 3).zip | 2011-12-05 12:43 | 618K | |
![[ ]](/icons/compressed.gif) | Milan System Disk (1998)(Milan-Computer-Systems)(de).zip | 2011-12-05 12:43 | 626K | |
![[ ]](/icons/compressed.gif) | CS-TeX v4.0 (1992)(Strunk, Christoph)(de-en)(Disk 3 of 8).zip | 2011-12-05 12:42 | 656K | |
![[ ]](/icons/compressed.gif) | CS-TeX v4.0 (1992)(Strunk, Christoph)(de-en)(Disk 7 of 8).zip | 2011-12-05 12:42 | 658K | |
![[ ]](/icons/compressed.gif) | Mix Machine +, The (19xx)(Dynamite Software)(Disk 2 of 3).zip | 2011-12-05 12:43 | 665K | |
![[ ]](/icons/compressed.gif) | Prism Paint (19xx)(-)[b].zip | 2011-12-05 12:43 | 677K | |
![[ ]](/icons/compressed.gif) | Eikona v2.04 (1993-10-06)(Marichal, B.)(fr)(Disk 2 of 2).zip | 2011-12-05 12:42 | 686K | |
![[ ]](/icons/compressed.gif) | POV 2 v1.32 (1993-10-16)(-)(Disk 1 of 3).zip | 2011-12-05 12:43 | 689K | |
![[ ]](/icons/compressed.gif) | POV 2 v1.32 (1993-10-16)(-)(Disk 2 of 3).zip | 2011-12-05 12:43 | 689K | |
![[ ]](/icons/compressed.gif) | Mix Machine +, The (19xx)(Dynamite Software)(Disk 3 of 3).zip | 2011-12-05 12:43 | 690K | |
![[ ]](/icons/compressed.gif) | Magellan v1.11 (demo) (19xx)(Cravero, Frederic - Olivares, David)[Falcon only].zip | 2011-12-05 12:43 | 695K | |
![[ ]](/icons/compressed.gif) | Crazy Sounds v1.23 (1992)(Maxon)(de)(Disk 1 of 2).zip | 2011-12-05 12:42 | 701K | |
![[ ]](/icons/compressed.gif) | Kleisterscheibe v2.33 (1992-04-17)(Brod, Klaus).zip | 2011-12-05 12:43 | 715K | |
![[ ]](/icons/compressed.gif) | Kleisterscheibe v2.33 (1992-04-17)(Brod, Klaus)[a].zip | 2011-12-05 12:43 | 715K | |
![[ ]](/icons/compressed.gif) | Muzaxx Rippozor v1.00 (1991)(Artis Magia)(fr).zip | 2011-12-05 12:43 | 727K | |
![[ ]](/icons/compressed.gif) | Automation Compacter v2.51 (1990)(LSD) & POV Pictures (19xx)(-).zip | 2011-12-05 12:42 | 761K | |
![[ ]](/icons/compressed.gif) | Compila (2002-09-24)(MJJ-Prod)(STE).zip | 2011-12-05 12:42 | 785K | |
![[ ]](/icons/compressed.gif) | Imagecopy v4.0 (1995-06-26)(Fast Club)(Disk 2 of 2).zip | 2011-12-05 12:43 | 786K | |
![[ ]](/icons/compressed.gif) | Effead'ed File Restorer Unpacker (19xx)(-).zip | 2011-12-05 12:42 | 807K | |
![[ ]](/icons/compressed.gif) | Imagecopy v4.01 (1996-12-15)(Fast Club)[cr Vectronix][One Disk].zip | 2011-12-05 12:43 | 1.1M | |
![[ ]](/icons/compressed.gif) | CAB v2.0 (19xx)(-)(de).zip | 2011-12-05 12:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | CAB v2.7 (19xx)(-)(de).zip | 2011-12-05 12:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Clarity (19xx)(-)[cr Elite][Falcon only].zip | 2011-12-05 12:42 | 1.4M | |
|